| 1 | ! **************************************************************
|
|---|
| 2 | !
|
|---|
| 3 | !
|
|---|
| 4 | ! This file contains the subroutines: addend, redchg, rplgrp
|
|---|
| 5 | !
|
|---|
| 6 | ! Copyright 2003-2005 Frank Eisenmenger, U.H.E. Hansmann,
|
|---|
| 7 | ! Shura Hayryan, Chin-Ku
|
|---|
| 8 | ! Copyright 2007 Frank Eisenmenger, U.H.E. Hansmann,
|
|---|
| 9 | ! Jan H. Meinke, Sandipan Mohanty
|
|---|
| 10 | !
|
|---|
| 11 | ! $Id: addend.f 334 2007-08-07 09:23:59Z meinke $
|
|---|
| 12 | ! **************************************************************
|
|---|
| 13 | subroutine addend(nml,grpn,grpc)
|
|---|
| 14 |
|
|---|
| 15 | ! ..............................................................
|
|---|
| 16 | ! PURPOSE: modify terminal residues to complete bonding scheme
|
|---|
| 17 | ! with residue 'grpn' at N- and residue 'grpc' at C-terminus
|
|---|
| 18 | ! ! need initial co-ordinates for residues to modify
|
|---|
| 19 | ! ! for N-terminus: may add only simple groups
|
|---|
| 20 | !
|
|---|
| 21 | ! CALLS: rplgrp,tolost,redchg
|
|---|
| 22 | ! ..............................................................
|
|---|
| 23 |
|
|---|
| 24 | include 'INCL.H'
|
|---|
| 25 |
|
|---|
| 26 | character grpn*4,grpc*4
|
|---|
| 27 |
|
|---|
| 28 | character res*4,rpat*4,sbrs*4,grn*4,grc*4
|
|---|
| 29 |
|
|---|
| 30 | integer nml
|
|---|
| 31 |
|
|---|
| 32 | integer i, ifirs, ilars
|
|---|
| 33 |
|
|---|
| 34 | double precision cg
|
|---|
| 35 |
|
|---|
| 36 | grn = grpn
|
|---|
| 37 | call tolost(grn)
|
|---|
| 38 | grc = grpc
|
|---|
| 39 | call tolost(grc)
|
|---|
| 40 |
|
|---|
| 41 | if (grn(:3).eq.'ace'.or.grc(:3).eq.'ace'
|
|---|
| 42 | &.or.grn(:3).eq.'nme'.or.grc(:3).eq.'nme') then
|
|---|
| 43 |
|
|---|
| 44 | write(*,'(2a)') ' addend> N-Acetyl (ace) or N-Methylamide (nme)'
|
|---|
| 45 | & ,' should be put in SEQUENCE file, not added as end groups'
|
|---|
| 46 |
|
|---|
| 47 | stop
|
|---|
| 48 | endif
|
|---|
| 49 |
|
|---|
| 50 | ! __________________________________________ N-terminus
|
|---|
| 51 | ifirs=irsml1(nml)
|
|---|
| 52 | rpat='n '
|
|---|
| 53 | res=seq(ifirs)
|
|---|
| 54 | call tolost(res)
|
|---|
| 55 | if (res(:3).ne.'ace') then
|
|---|
| 56 | if (grn(:3).eq.'nh2') then
|
|---|
| 57 | if (res(:3).eq.'hyp'.and..not.flex) then
|
|---|
| 58 | if(sh2) then
|
|---|
| 59 | sbrs='nh2+'
|
|---|
| 60 | else
|
|---|
| 61 | write (*,'(2a)') ' addend> ',
|
|---|
| 62 | & ' No N-terminal Hyp possible with ECEPP/3 dataset'
|
|---|
| 63 | stop
|
|---|
| 64 | endif
|
|---|
| 65 |
|
|---|
| 66 | elseif (res(:3).eq.'pro') then
|
|---|
| 67 | sbrs='nh1 '
|
|---|
| 68 | elseif (res(:3).eq.'gly'.and..not.flex) then
|
|---|
| 69 | if (sh2) then
|
|---|
| 70 | sbrs='nh2 '
|
|---|
| 71 | else
|
|---|
| 72 | sbrs='nh2g'
|
|---|
| 73 | endif
|
|---|
| 74 | else
|
|---|
| 75 | sbrs='nh2 '
|
|---|
| 76 | endif
|
|---|
| 77 |
|
|---|
| 78 | elseif (grn.eq.'nh3+') then
|
|---|
| 79 | if (res(:3).eq.'pro'.and..not.flex) then
|
|---|
| 80 | sbrs='nh2+'
|
|---|
| 81 | elseif (res(:3).eq.'gly'.and..not.flex) then
|
|---|
| 82 | sbrs='nh3g'
|
|---|
| 83 | else
|
|---|
| 84 | sbrs='nh3+'
|
|---|
| 85 | endif
|
|---|
| 86 |
|
|---|
| 87 | else
|
|---|
| 88 |
|
|---|
| 89 | write(*,'(2a)') ' addend> Can add only ',
|
|---|
| 90 | & 'nh2 or nh3+ to N-terminus'
|
|---|
| 91 | stop
|
|---|
| 92 |
|
|---|
| 93 | endif
|
|---|
| 94 |
|
|---|
| 95 | call rplgrp(nml,ifirs,rpat,sbrs)
|
|---|
| 96 | if (flex) call redchg(nml,ifirs,rpat,sbrs) ! Flex dataset
|
|---|
| 97 |
|
|---|
| 98 | else ! ace
|
|---|
| 99 |
|
|---|
| 100 | write(*,'(2a)') ' addend> Acetyl group',
|
|---|
| 101 | & ' at N-terminus not modified'
|
|---|
| 102 | endif
|
|---|
| 103 |
|
|---|
| 104 | ! __________________________________________ C-terminus
|
|---|
| 105 | ilars=irsml2(nml)
|
|---|
| 106 | rpat='c '
|
|---|
| 107 | res=seq(ilars)
|
|---|
| 108 | call tolost(res)
|
|---|
| 109 |
|
|---|
| 110 | if (res(:3).ne.'nme') then
|
|---|
| 111 |
|
|---|
| 112 | if (grc.eq.'cooh') then
|
|---|
| 113 |
|
|---|
| 114 | if (res(:3).eq.'gly'.and..not.sh2) then
|
|---|
| 115 | sbrs='gooh'
|
|---|
| 116 | else
|
|---|
| 117 | sbrs='cooh'
|
|---|
| 118 | endif
|
|---|
| 119 |
|
|---|
| 120 | elseif (grc.eq.'coo-') then
|
|---|
| 121 |
|
|---|
| 122 | if (res(:3).eq.'gly'.and..not.sh2) then
|
|---|
| 123 | sbrs='goo-'
|
|---|
| 124 | else
|
|---|
| 125 | sbrs='coo-'
|
|---|
| 126 | endif
|
|---|
| 127 |
|
|---|
| 128 | else
|
|---|
| 129 |
|
|---|
| 130 | write(*,'(2a)') ' addend> Can add only ',
|
|---|
| 131 | & 'cooh or coo- to C-terminus'
|
|---|
| 132 | stop
|
|---|
| 133 |
|
|---|
| 134 | endif
|
|---|
| 135 |
|
|---|
| 136 | call rplgrp(nml,ilars,rpat,sbrs)
|
|---|
| 137 | if (flex) call redchg(nml,ilars,rpat,sbrs) ! Flex dataset
|
|---|
| 138 |
|
|---|
| 139 | else ! N'-methylamide
|
|---|
| 140 |
|
|---|
| 141 | write(*,'(2a)') ' addend> N-Methylamide',
|
|---|
| 142 | & ' at C-terminus not modified'
|
|---|
| 143 |
|
|---|
| 144 | endif
|
|---|
| 145 |
|
|---|
| 146 | ! ----------------------------- net charge of molecule
|
|---|
| 147 | cg = 0.d0
|
|---|
| 148 | do i=iatrs1(irsml1(nml)),iatrs2(irsml2(nml))
|
|---|
| 149 | cg = cg + cgat(i)
|
|---|
| 150 | enddo
|
|---|
| 151 | if (abs(cg).gt.1.d-5) write(*,'(a,i2,a,f7.3,/)')
|
|---|
| 152 | & ' addend> Net charge of molecule #'
|
|---|
| 153 | & ,nml,': ',cg
|
|---|
| 154 |
|
|---|
| 155 | return
|
|---|
| 156 | end
|
|---|
| 157 | ! ****************************************
|
|---|
| 158 | subroutine rplgrp(nml,nrs,rpat,sbrs)
|
|---|
| 159 |
|
|---|
| 160 | ! ...............................................................
|
|---|
| 161 | ! PURPOSE: replace atom(s) rooted at atom 'rpat' in residue
|
|---|
| 162 | ! 'nrs' of molecule 'nml' by atom(s) rooted at
|
|---|
| 163 | ! 'rpat' of residue 'sbrs' (same name of root
|
|---|
| 164 | ! atom 'rpat' maintains bonding geometry for
|
|---|
| 165 | ! preceeding atoms in 'nrs')
|
|---|
| 166 | !
|
|---|
| 167 | ! is NOT performed if 'rpat' is within mainchain,
|
|---|
| 168 | ! except it is first/last mainchain atom of 'nml'
|
|---|
| 169 | !
|
|---|
| 170 | ! CALLS: dihedr,iopfil,iendst,eyring,fndbrn,redres,setsys,valang
|
|---|
| 171 | ! ...............................................................
|
|---|
| 172 |
|
|---|
| 173 | include 'INCL.H'
|
|---|
| 174 |
|
|---|
| 175 | character rpat*4,sbrs*4
|
|---|
| 176 | logical ntbb,bb
|
|---|
| 177 | integer nml, nrs, ibd, iybd
|
|---|
| 178 |
|
|---|
| 179 | dimension ibd(mxbd+1),iybd(mxbd+1)
|
|---|
| 180 |
|
|---|
| 181 | integer iopfil, iendst
|
|---|
| 182 |
|
|---|
| 183 | double precision valang, dihedr
|
|---|
| 184 |
|
|---|
| 185 | integer ish, i, i1, irng1, irng2, ilavr, ilaat, i2, i3, ibdrg,
|
|---|
| 186 | & ib, iat, ifirs, ifivr, ii, iow, isgbb1, ity, nfi, ilars,
|
|---|
| 187 | & ivrrp, ivrsb, jsh, j, iybdrg, k, lvrrp, nb, natsb, nla,
|
|---|
| 188 | & nfirp, nxt, nsb, nlarp, nfisb, nlasb, nrp, nsh,
|
|---|
| 189 | & nvrsb, nxtbb1, nxtbb2, nxtsb
|
|---|
| 190 | double precision ba, ca, ct, dx, dz, h3, h2, sa, st,to, x1, x2,
|
|---|
| 191 | & x3, y1, y2, y3, z1, z2, z3
|
|---|
| 192 |
|
|---|
| 193 | ifirs=irsml1(nml)
|
|---|
| 194 | ilars=irsml2(nml)
|
|---|
| 195 |
|
|---|
| 196 | nxt=ixatrs(nrs)
|
|---|
| 197 | nfi=iatrs1(nrs)
|
|---|
| 198 | nla=iatrs2(nrs)
|
|---|
| 199 | ! __________________________ indices of atoms to be replaced
|
|---|
| 200 | do i=nfi,nla
|
|---|
| 201 | if (rpat.eq.nmat(i)) then
|
|---|
| 202 | nfirp=i
|
|---|
| 203 | goto 1
|
|---|
| 204 | endif
|
|---|
| 205 | enddo
|
|---|
| 206 | write (*,'(4a,i4,a,i4)') ' rplgrp> cannot find atom >',rpat,
|
|---|
| 207 | &'< to be replaced in residue ',seq(nrs),nrs,' of molecule ',nml
|
|---|
| 208 | stop
|
|---|
| 209 |
|
|---|
| 210 | 1 call fndbrn(nml,nrs,nfirp,nlarp,irng1,irng2,bb)
|
|---|
| 211 | if (irng1.gt.0) goto 10
|
|---|
| 212 | ntbb=.false.
|
|---|
| 213 |
|
|---|
| 214 | if (bb) then ! ..... backbone
|
|---|
| 215 |
|
|---|
| 216 | if (nfirp.eq.nxt.and.nrs.eq.ilars) goto 2 ! last mainchain atom
|
|---|
| 217 |
|
|---|
| 218 | if (nfirp.eq.nfi.and.nrs.eq.ifirs) then ! 1st MAINCHAIN ATOM !
|
|---|
| 219 |
|
|---|
| 220 | ntbb=.true.
|
|---|
| 221 |
|
|---|
| 222 | ibd(1)=iowat(nfirp)
|
|---|
| 223 | iybd(1)=iyowat(nfirp)
|
|---|
| 224 |
|
|---|
| 225 | do i=1,mxbd
|
|---|
| 226 | ibd(i+1)=ibdat(i,nfirp)
|
|---|
| 227 | iybd(i+1)=iybdat(i,nfirp)
|
|---|
| 228 | enddo
|
|---|
| 229 |
|
|---|
| 230 | ibdrg=0 ! __________________ check ring
|
|---|
| 231 | iybdrg=1
|
|---|
| 232 |
|
|---|
| 233 | do i=1,nbdat(nfirp)+1
|
|---|
| 234 | if (iowat(ibd(i)).ne.nfirp) then
|
|---|
| 235 | if (ibdrg.ne.0) then
|
|---|
| 236 | write (*,'(2a,i3)')
|
|---|
| 237 | & ' rplgrp> Can handle only simple ring at 1st',
|
|---|
| 238 | & ' atom of molecule #',nml
|
|---|
| 239 | stop
|
|---|
| 240 | endif
|
|---|
| 241 | ibdrg=ibd(i)
|
|---|
| 242 | iybdrg=iybd(i)
|
|---|
| 243 | endif
|
|---|
| 244 | enddo
|
|---|
| 245 | nxtbb1=nlarp+1 ! _________________ next backbone atoms
|
|---|
| 246 | isgbb1=iyowat(nxtbb1)
|
|---|
| 247 |
|
|---|
| 248 | if (nxtbb1.eq.nxt) then
|
|---|
| 249 | if (nrs.lt.ilars) then
|
|---|
| 250 | nxtbb2=iatrs1(nrs+1)
|
|---|
| 251 | goto 3
|
|---|
| 252 | endif
|
|---|
| 253 | else
|
|---|
| 254 | do i=nxt,nxtbb1+1,-1
|
|---|
| 255 | if (iowat(i).eq.nxtbb1) then
|
|---|
| 256 | nxtbb2=i
|
|---|
| 257 | goto 3
|
|---|
| 258 | endif
|
|---|
| 259 | enddo
|
|---|
| 260 | endif
|
|---|
| 261 | goto 11
|
|---|
| 262 | else
|
|---|
| 263 | write (*,'(4a,i4,a,i4)')
|
|---|
| 264 | & ' rplgrp> Cannot replace BACKBONE atom ',rpat,
|
|---|
| 265 | & ' of residue ',seq(nrs),nrs,' in molecule #',nml
|
|---|
| 266 | stop
|
|---|
| 267 | endif
|
|---|
| 268 |
|
|---|
| 269 | endif ! N-terminus
|
|---|
| 270 | ! _________________________________ previous atoms
|
|---|
| 271 | 2 if (nfirp.eq.nfi.and.nrs.eq.ifirs) goto 11
|
|---|
| 272 | nxtbb1=iowat(nfirp)
|
|---|
| 273 | if (nxtbb1.eq.nfi.and.nrs.eq.ifirs) goto 11
|
|---|
| 274 | nxtbb2=iowat(nxtbb1)
|
|---|
| 275 | ! _______________________________ get data for substituent atoms
|
|---|
| 276 | 3 if (iopfil(lunlib,reslib,'old','formatted').le.izero) then
|
|---|
| 277 | write (*,'(a,/,a,i3,2a)')
|
|---|
| 278 | & ' rplgrp> ERROR opening library of residues:',
|
|---|
| 279 | & ' LUN=',lunlib,' FILE=',reslib(1:iendst(reslib))
|
|---|
| 280 | stop
|
|---|
| 281 | endif
|
|---|
| 282 | call redres(sbrs,natsb,nxtsb,nvrsb)
|
|---|
| 283 | close (lunlib)
|
|---|
| 284 | ! __________________________ indices of substituent atoms
|
|---|
| 285 | do i=1,natsb
|
|---|
| 286 | if (rpat.eq.nmath(i)) then
|
|---|
| 287 | nfisb=i
|
|---|
| 288 | goto 4
|
|---|
| 289 | endif
|
|---|
| 290 | enddo
|
|---|
| 291 | write (*,'(4a)') ' rplgrp> Cannot find atom >',rpat,
|
|---|
| 292 | &'< in substituent residue ',sbrs
|
|---|
| 293 | stop
|
|---|
| 294 |
|
|---|
| 295 | 4 nlasb=nfisb
|
|---|
| 296 | do i=1,nbdath(nfisb)
|
|---|
| 297 | ib=ibdath(i,nfisb)
|
|---|
| 298 | if (iowath(ib).lt.nfisb) goto 10
|
|---|
| 299 | do j=ib,natsb
|
|---|
| 300 | if (j.gt.ib.and.iowath(j).lt.ib) goto 5
|
|---|
| 301 | do k=1,nbdath(j)
|
|---|
| 302 | if (ibdath(k,j).lt.nfisb) goto 10
|
|---|
| 303 | enddo
|
|---|
| 304 | nlasb=j
|
|---|
| 305 | enddo ! ... branch atoms
|
|---|
| 306 | 5 enddo ! ... branches
|
|---|
| 307 | ! _________________________________________________ local axes at 'nfirp'
|
|---|
| 308 | call setsys(nxtbb1,nfirp,nxtbb2,x1,x2,x3,y1,y2,y3,z1,z2,z3)
|
|---|
| 309 |
|
|---|
| 310 | xtoat(nfirp)=x1
|
|---|
| 311 | ytoat(nfirp)=x2
|
|---|
| 312 | ztoat(nfirp)=x3
|
|---|
| 313 | xbaat(nfirp)=z1
|
|---|
| 314 | ybaat(nfirp)=z2
|
|---|
| 315 | zbaat(nfirp)=z3
|
|---|
| 316 |
|
|---|
| 317 | ! _____________________ add virtual atoms
|
|---|
| 318 | if (ntbb) then
|
|---|
| 319 |
|
|---|
| 320 | ct=cstoat(nxtbb2) ! t.angle_(+2)
|
|---|
| 321 | st=sntoat(nxtbb2)
|
|---|
| 322 | ca=csbaat(nxtbb1) ! b.angle_(+1)
|
|---|
| 323 | sa=snbaat(nxtbb1)
|
|---|
| 324 |
|
|---|
| 325 | ! ------------------- Eyring
|
|---|
| 326 | h2=-sa*ct
|
|---|
| 327 | h3=-sa*st
|
|---|
| 328 | x1=-ca*x1+h2*y1+h3*z1
|
|---|
| 329 | x2=-ca*x2+h2*y2+h3*z2
|
|---|
| 330 | x3=-ca*x3+h2*y3+h3*z3
|
|---|
| 331 | dx=one/sqrt(x1*x1+x2*x2+x3*x3)
|
|---|
| 332 | x1=x1*dx
|
|---|
| 333 | x2=x2*dx
|
|---|
| 334 | x3=x3*dx
|
|---|
| 335 |
|
|---|
| 336 | xat(izero)=xat(nfirp)+x1
|
|---|
| 337 | yat(izero)=yat(nfirp)+x2
|
|---|
| 338 | zat(izero)=zat(nfirp)+x3
|
|---|
| 339 | z1=-st*y1+ct*z1
|
|---|
| 340 | z2=-st*y2+ct*z2
|
|---|
| 341 | z3=-st*y3+ct*z3
|
|---|
| 342 | dz=one/sqrt(z1*z1+z2*z2+z3*z3)
|
|---|
| 343 | z1=z1*dz
|
|---|
| 344 | z2=z2*dz
|
|---|
| 345 | z3=z3*dz
|
|---|
| 346 |
|
|---|
| 347 | ct=cstoat(nxtbb1) ! t.angle_(+1)
|
|---|
| 348 | st=sntoat(nxtbb1)
|
|---|
| 349 |
|
|---|
| 350 | ! -------------------- Eyring with b.angle = 90 deg.
|
|---|
| 351 | xat(-ione)=xat(izero)-ct*(z2*x3-z3*x2)-st*z1
|
|---|
| 352 | yat(-ione)=yat(izero)-ct*(z3*x1-z1*x3)-st*z2
|
|---|
| 353 | zat(-ione)=zat(izero)-ct*(z1*x2-z2*x1)-st*z3
|
|---|
| 354 |
|
|---|
| 355 | endif
|
|---|
| 356 | ! _____________________________________________ Shift atom data
|
|---|
| 357 | nrp=nlarp-nfirp
|
|---|
| 358 | nsb=nlasb-nfisb
|
|---|
| 359 | if (nrp.ne.nsb) then
|
|---|
| 360 | nsh=nsb-nrp
|
|---|
| 361 | do i=nfi,nfirp-1 ! bonds to atoms after repl. group
|
|---|
| 362 | do j=1,mxbd
|
|---|
| 363 | ib=ibdat(j,i)
|
|---|
| 364 | if (ib.gt.nlarp.and.ib.le.nla) ibdat(j,i)=ib+nsh
|
|---|
| 365 | enddo
|
|---|
| 366 | enddo
|
|---|
| 367 | ilaat=iatrs2(irsml2(ntlml))
|
|---|
| 368 | if (nrp.gt.nsb) then ! less atoms
|
|---|
| 369 | i1=nlarp+1
|
|---|
| 370 | i2=ilaat
|
|---|
| 371 | i3=1
|
|---|
| 372 | else ! more atoms
|
|---|
| 373 | if ((ilaat+nsh).gt.mxat) then
|
|---|
| 374 | write (*,'(a,i5)') ' rplgrp> number of atoms > ',mxat
|
|---|
| 375 | stop
|
|---|
| 376 | endif
|
|---|
| 377 |
|
|---|
| 378 | i1=ilaat
|
|---|
| 379 | i2=nlarp+1
|
|---|
| 380 | i3=-1
|
|---|
| 381 | endif
|
|---|
| 382 |
|
|---|
| 383 | do i=i1,i2,i3
|
|---|
| 384 | ii=i+nsh
|
|---|
| 385 | nbdat(ii)=nbdat(i)
|
|---|
| 386 |
|
|---|
| 387 | ibd(1)=iowat(i)
|
|---|
| 388 | iybd(1)=iyowat(i)
|
|---|
| 389 | do j = 1,mxbd
|
|---|
| 390 | ibd(j+1)=ibdat(j,i)
|
|---|
| 391 | iybd(j+1)=iybdat(j,i)
|
|---|
| 392 | enddo
|
|---|
| 393 |
|
|---|
| 394 | do j=1,mxbd+1
|
|---|
| 395 | if (ibd(j).gt.nfirp) ibd(j)=ibd(j)+nsh
|
|---|
| 396 | enddo
|
|---|
| 397 |
|
|---|
| 398 | iowat(ii)=ibd(1)
|
|---|
| 399 | iyowat(ii)=iybd(1)
|
|---|
| 400 | do j = 1,mxbd
|
|---|
| 401 | ibdat(j,ii)=ibd(j+1)
|
|---|
| 402 | iybdat(j,ii)=iybd(j+1)
|
|---|
| 403 | enddo
|
|---|
| 404 |
|
|---|
| 405 | ityat(ii)=ityat(i)
|
|---|
| 406 | nmat(ii)=nmat(i)
|
|---|
| 407 | cgat(ii)=cgat(i)
|
|---|
| 408 | blat(ii)=blat(i)
|
|---|
| 409 | baat(ii)=baat(i)
|
|---|
| 410 | snbaat(ii)=snbaat(i)
|
|---|
| 411 | csbaat(ii)=csbaat(i)
|
|---|
| 412 | toat(ii)=toat(i)
|
|---|
| 413 | sntoat(ii)=sntoat(i)
|
|---|
| 414 | cstoat(ii)=cstoat(i)
|
|---|
| 415 | xat(ii)=xat(i)
|
|---|
| 416 | yat(ii)=yat(i)
|
|---|
| 417 | zat(ii)=zat(i)
|
|---|
| 418 | xtoat(ii)=xtoat(i)
|
|---|
| 419 | ytoat(ii)=ytoat(i)
|
|---|
| 420 | ztoat(ii)=ztoat(i)
|
|---|
| 421 | xbaat(ii)=xbaat(i)
|
|---|
| 422 | ybaat(ii)=ybaat(i)
|
|---|
| 423 | zbaat(ii)=zbaat(i)
|
|---|
| 424 |
|
|---|
| 425 | enddo
|
|---|
| 426 | ! ____________________________________________ Shift residue data
|
|---|
| 427 | do i=nrs+1,irsml2(ntlml)
|
|---|
| 428 | iatrs1(i)=iatrs1(i)+nsh
|
|---|
| 429 | iatrs2(i)=iatrs2(i)+nsh
|
|---|
| 430 | ixatrs(i)=ixatrs(i)+nsh
|
|---|
| 431 | enddo
|
|---|
| 432 | iatrs2(nrs)=nla+nsh
|
|---|
| 433 | if (nxt.gt.nlarp) ixatrs(nrs)=nxt+nsh
|
|---|
| 434 | else
|
|---|
| 435 | nsh=0
|
|---|
| 436 | endif
|
|---|
| 437 | ! _________________________________________ Correct data of 'nfirp'
|
|---|
| 438 | ish=nfirp-nfisb
|
|---|
| 439 | ityat(nfirp)=ityath(nfisb)
|
|---|
| 440 |
|
|---|
| 441 | if(.not.sh2) cgat(nfirp)=cgath(nfisb) ! NOT for 'ECEPP/2'
|
|---|
| 442 |
|
|---|
| 443 | nb=nbdath(nfisb) ! _______________ Bonds
|
|---|
| 444 |
|
|---|
| 445 | do i=1,mxbd
|
|---|
| 446 | ib=ibdath(i,nfisb)
|
|---|
| 447 | if (ib.ne.0) then
|
|---|
| 448 | ibd(i)=ib+ish
|
|---|
| 449 | iybd(i)=iybdath(i,nfisb)
|
|---|
| 450 | else
|
|---|
| 451 | ibd(i)=0
|
|---|
| 452 | iybd(i)=1
|
|---|
| 453 | endif
|
|---|
| 454 |
|
|---|
| 455 | enddo
|
|---|
| 456 |
|
|---|
| 457 | if (ntbb) then
|
|---|
| 458 |
|
|---|
| 459 | ibd(mxbd+1)=0
|
|---|
| 460 | iybd(mxbd+1)=1
|
|---|
| 461 |
|
|---|
| 462 | ibd(nb+1)=nxtbb1+nsh ! bond to next backbone atom
|
|---|
| 463 | iybd(nb+1)=isgbb1
|
|---|
| 464 |
|
|---|
| 465 | if (ibdrg.ne.0) then
|
|---|
| 466 | nb=nb+1
|
|---|
| 467 | if (nb.gt.mxbd) then
|
|---|
| 468 | write (*,'(6a,/,2a,3(i4,a))')
|
|---|
| 469 | & ' rplgrp> Cannot add atoms following ',rpat,
|
|---|
| 470 | & ' from group ',sbrs,' to atom ',rpat,
|
|---|
| 471 | & ' of residue ',seq(nrs),nrs,' in molecule #',nml,
|
|---|
| 472 | & ' because need >',(mxbd+1),' bonds'
|
|---|
| 473 | stop
|
|---|
| 474 | endif
|
|---|
| 475 | ibd(nb+1)=ibdrg+nsh
|
|---|
| 476 | iybd(nb+1)=iybdrg
|
|---|
| 477 | endif
|
|---|
| 478 | iowat(nfirp)=ibd(1)
|
|---|
| 479 | iyowat(nfirp)=iybd(1)
|
|---|
| 480 | do i=1,mxbd
|
|---|
| 481 | ibdat(i,nfirp)=ibd(i+1)
|
|---|
| 482 | iybdat(i,nfirp)=iybd(i+1)
|
|---|
| 483 | enddo
|
|---|
| 484 | else ! not 'ntbb'
|
|---|
| 485 |
|
|---|
| 486 | do i=1,mxbd
|
|---|
| 487 | ibdat(i,nfirp)=ibd(i)
|
|---|
| 488 | iybdat(i,nfirp)=iybd(i)
|
|---|
| 489 | enddo
|
|---|
| 490 |
|
|---|
| 491 | endif
|
|---|
| 492 | nbdat(nfirp)=nb
|
|---|
| 493 | ! _________________________________________ Add data for substituent
|
|---|
| 494 | ii=nfirp
|
|---|
| 495 | do i=nfisb+1,nlasb
|
|---|
| 496 | ii=ii+1
|
|---|
| 497 | nbdat(ii)=nbdath(i)
|
|---|
| 498 |
|
|---|
| 499 | iow=iowath(i)+ish
|
|---|
| 500 | iowat(ii)=iow
|
|---|
| 501 | iyowat(ii)=iyowath(i)
|
|---|
| 502 |
|
|---|
| 503 | do j=1,mxbd
|
|---|
| 504 | ib=ibdath(j,i)
|
|---|
| 505 | if (ib.ge.nfisb) then
|
|---|
| 506 | ibdat(j,ii)=ib+ish
|
|---|
| 507 | else
|
|---|
| 508 | ibdat(j,ii)=ib
|
|---|
| 509 | endif
|
|---|
| 510 | iybdat(j,ii)=iybdath(j,i)
|
|---|
| 511 | enddo
|
|---|
| 512 |
|
|---|
| 513 | ityat(ii)=ityath(i)
|
|---|
| 514 | nmat(ii)=nmath(i)
|
|---|
| 515 | cgat(ii)=cgath(i)
|
|---|
| 516 | blat(ii)=blath(i)
|
|---|
| 517 | ba=baath(i)
|
|---|
| 518 | baat(ii)=ba
|
|---|
| 519 | csbaat(ii)=cos(ba)
|
|---|
| 520 | snbaat(ii)=sin(ba)
|
|---|
| 521 | to=toath(i)
|
|---|
| 522 | toat(ii)=to
|
|---|
| 523 | cstoat(ii)=cos(to)
|
|---|
| 524 | sntoat(ii)=sin(to)
|
|---|
| 525 | call eyring(ii,iow)
|
|---|
| 526 | if (ntbb) then ! reset some internal coordinates
|
|---|
| 527 | if (iow.eq.nfirp) then
|
|---|
| 528 | ba=valang(izero,nfirp,ii)
|
|---|
| 529 | baat(ii)=ba
|
|---|
| 530 | csbaat(ii)=cos(ba)
|
|---|
| 531 | snbaat(ii)=sin(ba)
|
|---|
| 532 | to=dihedr(-ione,izero,nfirp,ii)
|
|---|
| 533 | toat(ii)=to
|
|---|
| 534 | cstoat(ii)=cos(to)
|
|---|
| 535 | sntoat(ii)=sin(to)
|
|---|
| 536 | elseif (iowat(iow).eq.nfirp) then
|
|---|
| 537 | to=dihedr(izero,nfirp,iow,ii)
|
|---|
| 538 | toat(ii)=to
|
|---|
| 539 | cstoat(ii)=cos(to)
|
|---|
| 540 | sntoat(ii)=sin(to)
|
|---|
| 541 | endif
|
|---|
| 542 |
|
|---|
| 543 | endif ! ntbb
|
|---|
| 544 |
|
|---|
| 545 | enddo ! substituent atoms
|
|---|
| 546 | ! ___________________________________________________ Take care of Variables
|
|---|
| 547 | ! (assume variables of replaced group/substituent to be stored CONSECUTIVELY)
|
|---|
| 548 |
|
|---|
| 549 | ilavr=ivrml1(ntlml)+nvrml(ntlml)-1
|
|---|
| 550 | ifivr=ivrrs1(nrs) ! variables to be replaced (#=ivrrp,last=lvrrp)
|
|---|
| 551 | ivrrp=0
|
|---|
| 552 | do i=ifivr,ifivr+nvrrs(nrs)-1
|
|---|
| 553 | iat=iatvr(i)
|
|---|
| 554 | if (nfirp.lt.iat.and.iat.le.nlarp) then
|
|---|
| 555 | ivrrp=ivrrp+1
|
|---|
| 556 | lvrrp=i
|
|---|
| 557 | endif
|
|---|
| 558 | enddo
|
|---|
| 559 | if (ivrrp.eq.0) then ! No variables to replace
|
|---|
| 560 | do i=ifivr,ilavr
|
|---|
| 561 | if (iatvr(i).gt.nlarp) then
|
|---|
| 562 | lvrrp=i-1
|
|---|
| 563 | goto 6
|
|---|
| 564 | endif
|
|---|
| 565 | enddo
|
|---|
| 566 | lvrrp=ilavr
|
|---|
| 567 | endif
|
|---|
| 568 | 6 ivrsb=0 ! variables from substituent (#=ivrsb)
|
|---|
| 569 | do i=1,nvrsb
|
|---|
| 570 | iat=iatvrh(i)
|
|---|
| 571 | if (nfisb.lt.iat.and.iat.le.nlasb) then
|
|---|
| 572 | ity=ityvrh(i)
|
|---|
| 573 | if (ntbb.and.iowath(iat).eq.nfisb.and.ity.gt.2) goto 7
|
|---|
| 574 | ivrsb=ivrsb+1
|
|---|
| 575 | nmvrh(ivrsb)=nmvrh(i)
|
|---|
| 576 | ityvrh(ivrsb)=ityvrh(i)
|
|---|
| 577 | iclvrh(ivrsb)=iclvrh(i)
|
|---|
| 578 | iatvrh(ivrsb)=iat
|
|---|
| 579 | endif
|
|---|
| 580 | 7 enddo
|
|---|
| 581 | if (nsh.ne.0) then ! if # of atoms changed
|
|---|
| 582 | do i=lvrrp+1,ilavr
|
|---|
| 583 | iatvr(i)=iatvr(i)+nsh
|
|---|
| 584 | enddo
|
|---|
| 585 | endif
|
|---|
| 586 |
|
|---|
| 587 | if (ivrrp.ne.ivrsb) then ! shift data for variables
|
|---|
| 588 | jsh=ivrsb-ivrrp
|
|---|
| 589 | if (ivrrp.gt.ivrsb) then
|
|---|
| 590 | i1=lvrrp+1
|
|---|
| 591 | i2=ilavr
|
|---|
| 592 | i3=1
|
|---|
| 593 | else
|
|---|
| 594 | if ((ilavr+jsh).gt.mxvr) then
|
|---|
| 595 | write (*,'(a,i5)') ' rplgrp> number of variables > ',mxvr
|
|---|
| 596 | stop
|
|---|
| 597 | endif
|
|---|
| 598 | i1=ilavr
|
|---|
| 599 | i2=lvrrp+1
|
|---|
| 600 | i3=-1
|
|---|
| 601 | endif
|
|---|
| 602 | do i=i1,i2,i3
|
|---|
| 603 | ii=i+jsh
|
|---|
| 604 | ityvr(ii)=ityvr(i)
|
|---|
| 605 | iclvr(ii)=iclvr(i)
|
|---|
| 606 | nmvr(ii)=nmvr(i)
|
|---|
| 607 | iatvr(ii)=iatvr(i)
|
|---|
| 608 | enddo
|
|---|
| 609 |
|
|---|
| 610 | do i=nrs+1,irsml2(ntlml)
|
|---|
| 611 | ivrrs1(i)=ivrrs1(i)+jsh
|
|---|
| 612 | enddo
|
|---|
| 613 | nvrrs(nrs)=nvrrs(nrs)+jsh
|
|---|
| 614 | nvrml(nml)=nvrml(nml)+jsh
|
|---|
| 615 | do i=nml+1,ntlml
|
|---|
| 616 | ivrml1(i)=ivrml1(i)+jsh
|
|---|
| 617 | enddo
|
|---|
| 618 | endif
|
|---|
| 619 | ii=lvrrp-ivrrp ! Add variables for substitutent
|
|---|
| 620 | do i=1,ivrsb
|
|---|
| 621 | ii=ii+1
|
|---|
| 622 | nmvr(ii)=nmvrh(i)
|
|---|
| 623 | ityvr(ii)=ityvrh(i)
|
|---|
| 624 | iclvr(ii)=iclvrh(i)
|
|---|
| 625 | iatvr(ii)=iatvrh(i)+ish
|
|---|
| 626 | enddo
|
|---|
| 627 |
|
|---|
| 628 | return
|
|---|
| 629 | ! __________________________________________ Errors
|
|---|
| 630 | 10 write (*,'(3a,/,2a,i4,a,i4,/,2a)')
|
|---|
| 631 | & ' rplgrp> Cannot replace atom(s) following ',rpat,
|
|---|
| 632 | & ' from INSIDE a ring',' in residue: ',seq(nrs),nrs,
|
|---|
| 633 | & ' in molecule #',nml,' or in substitute: ',sbrs
|
|---|
| 634 | stop
|
|---|
| 635 | 11 write (*,'(4a,i4,a,i4,/,a)')
|
|---|
| 636 | & ' rplgrp> Cannot replace atom(s) following ',rpat,
|
|---|
| 637 | & ' of residue ',seq(nrs),nrs,' in molecule #',nml,
|
|---|
| 638 | & ' since necessary 2 previous atoms are not available'
|
|---|
| 639 | stop
|
|---|
| 640 |
|
|---|
| 641 | end
|
|---|
| 642 | ! ****************************************
|
|---|
| 643 | subroutine redchg(nml,nrs,rpat,sbrs)
|
|---|
| 644 |
|
|---|
| 645 | ! .........................................................
|
|---|
| 646 | ! PURPOSE: read and place atomic point charges from residue
|
|---|
| 647 | ! 'sbrs' to residue 'nrs' of molecule 'nml'
|
|---|
| 648 | ! from library 'chglib' with LUN=lunchg, if ilib=1
|
|---|
| 649 | ! 'reslib' with LUN=lunlib, if ilib=2
|
|---|
| 650 | !
|
|---|
| 651 | ! CALLS: iopfil,iendst,tolost
|
|---|
| 652 | ! ........................................................
|
|---|
| 653 |
|
|---|
| 654 | include 'INCL.H'
|
|---|
| 655 |
|
|---|
| 656 | character rpat*4,sbrs*4,atnm*4,res*4,cgty*5,line*100
|
|---|
| 657 | integer nml, nrs
|
|---|
| 658 |
|
|---|
| 659 | integer iopfil, iendst
|
|---|
| 660 |
|
|---|
| 661 | integer ifirs, ilars, ifvr, ilib, i, l, j, nchg
|
|---|
| 662 |
|
|---|
| 663 | ifirs=irsml1(nml)
|
|---|
| 664 | ilars=irsml2(nml)
|
|---|
| 665 | res=seq(nrs)
|
|---|
| 666 | call tolost(res)
|
|---|
| 667 |
|
|---|
| 668 | if (nrs.eq.ifirs.or.nrs.eq.ilars) then
|
|---|
| 669 |
|
|---|
| 670 | if (rpat.eq.'n '.or.rpat.eq.'c ') then
|
|---|
| 671 | if (nrs.eq.ifirs.and.nrs.eq.ilars) goto 10 ! Dont have this yet
|
|---|
| 672 |
|
|---|
| 673 | if (rpat.eq.'n '.and.nrs.eq.ifirs) then
|
|---|
| 674 | if (res(1:3).eq.'pro'.or.res(1:3).eq.'hyp') then
|
|---|
| 675 | if (sbrs.eq.'nh1 ') cgty='n'//res
|
|---|
| 676 | if (sbrs.eq.'nh2+') cgty='+'//res
|
|---|
| 677 | else
|
|---|
| 678 | if (sbrs.eq.'nh2 ') cgty='n'//res
|
|---|
| 679 | if (sbrs.eq.'nh3+') cgty='+'//res
|
|---|
| 680 | endif
|
|---|
| 681 | elseif (rpat.eq.'c '.and.nrs.eq.ilars) then
|
|---|
| 682 | if (sbrs.eq.'cooh') cgty='c'//res
|
|---|
| 683 | if (sbrs.eq.'coo-') cgty='-'//res
|
|---|
| 684 | else
|
|---|
| 685 | goto 10
|
|---|
| 686 | endif
|
|---|
| 687 | else
|
|---|
| 688 | write (*,*) ' redchg> dont know which end goup is present'
|
|---|
| 689 | stop
|
|---|
| 690 | endif
|
|---|
| 691 | ilib=1
|
|---|
| 692 | else
|
|---|
| 693 | cgty(1:)=sbrs
|
|---|
| 694 | ilib=2
|
|---|
| 695 | endif
|
|---|
| 696 |
|
|---|
| 697 | if (ilib.eq.1) then
|
|---|
| 698 |
|
|---|
| 699 | if (iopfil(lunchg,chgfil,'old','formatted').le.izero) then
|
|---|
| 700 | write (*,'(a,/,a,i3,2a)')
|
|---|
| 701 | & ' redchg> ERROR opening library of charges:',
|
|---|
| 702 | & ' LUN=',lunchg,' FILE=',chgfil(1:iendst(chgfil))
|
|---|
| 703 | stop
|
|---|
| 704 | endif
|
|---|
| 705 |
|
|---|
| 706 | 1 line=' '
|
|---|
| 707 | read (lunchg,'(a)',end=3) line
|
|---|
| 708 | l=iendst(line)
|
|---|
| 709 |
|
|---|
| 710 | if (l.ge.10.and.line(1:1).eq.'#'.and.line(2:6).eq.cgty) then
|
|---|
| 711 | read (line(7:10),'(i4)') nchg
|
|---|
| 712 | if (nchg.le.mxath) then
|
|---|
| 713 | read (lunchg,'(10(2x,a4,1x))') (nmath(i),i=1,nchg)
|
|---|
| 714 | read (lunchg,'(10(f6.4,1x))') (cgath(i),i=1,nchg)
|
|---|
| 715 | close(lunchg)
|
|---|
| 716 | do i=iatrs1(nrs),iatrs2(nrs)
|
|---|
| 717 | atnm=nmat(i)
|
|---|
| 718 | do j=1,nchg
|
|---|
| 719 | if (nmath(j).eq.atnm) then
|
|---|
| 720 | cgat(i)=cgath(j)
|
|---|
| 721 | goto 2
|
|---|
| 722 | endif
|
|---|
| 723 | enddo
|
|---|
| 724 | write (*,'(6a)') ' redchg> Cannot find atom: ',atnm,
|
|---|
| 725 | & ' for entry: ',cgty,' in library: ',
|
|---|
| 726 | & chgfil(1:iendst(chgfil))
|
|---|
| 727 | stop
|
|---|
| 728 | 2 enddo
|
|---|
| 729 | return
|
|---|
| 730 | else
|
|---|
| 731 | write (*,'(4a)')
|
|---|
| 732 | & ' redchg> must increase MXATH to read data for entry: ',
|
|---|
| 733 | & cgty,' in library: ',chgfil(1:iendst(chgfil))
|
|---|
| 734 | close(lunchg)
|
|---|
| 735 | stop
|
|---|
| 736 | endif
|
|---|
| 737 | endif
|
|---|
| 738 | goto 1
|
|---|
| 739 | 3 write (*,'(4a)')
|
|---|
| 740 | & ' redchg> Cannot find entry: ',cgty,' in library: ',
|
|---|
| 741 | & chgfil(1:iendst(chgfil))
|
|---|
| 742 | close(lunchg)
|
|---|
| 743 | stop
|
|---|
| 744 |
|
|---|
| 745 | elseif (ilib.eq.2) then
|
|---|
| 746 |
|
|---|
| 747 | if (iopfil(lunlib,reslib,'old','formatted').le.izero) then
|
|---|
| 748 | write (*,'(a,/,a,i3,2a)')
|
|---|
| 749 | & ' redchg> ERROR opening library of residues:',
|
|---|
| 750 | & ' LUN=',lunlib,' FILE=',reslib(1:iendst(reslib))
|
|---|
| 751 | stop
|
|---|
| 752 | endif
|
|---|
| 753 |
|
|---|
| 754 | 4 line=' '
|
|---|
| 755 | read (lunlib,'(a)',end=6) line
|
|---|
| 756 | l=iendst(line)
|
|---|
| 757 |
|
|---|
| 758 | if (l.ge.9.and.line(1:1).eq.'#'.and.line(2:5).eq.cgty(1:4)) then
|
|---|
| 759 | read (line(6:9),'(i4)') nchg
|
|---|
| 760 | if (nchg.le.mxath) then
|
|---|
| 761 | read (lunlib,'(a4,42x,d7.4)') (nmath(i),cgath(i),i=1,nchg)
|
|---|
| 762 | close(lunlib)
|
|---|
| 763 | do i=iatrs1(nrs),iatrs2(nrs)
|
|---|
| 764 | atnm=nmat(i)
|
|---|
| 765 | do j=1,nchg
|
|---|
| 766 | if (nmath(j).eq.atnm) then
|
|---|
| 767 | cgat(i)=cgath(j)
|
|---|
| 768 | goto 5
|
|---|
| 769 | endif
|
|---|
| 770 | enddo
|
|---|
| 771 | write (*,'(6a)') ' redchg> Cannot find atom: ',atnm,
|
|---|
| 772 | & ' for entry: ',cgty,' in library: ',
|
|---|
| 773 | & reslib(1:iendst(reslib))
|
|---|
| 774 | stop
|
|---|
| 775 | 5 enddo
|
|---|
| 776 | return
|
|---|
| 777 | else
|
|---|
| 778 | write (*,'(4a)')
|
|---|
| 779 | & ' redchg> must increase MXATH to read data for entry: ',
|
|---|
| 780 | & cgty,' in library: ',reslib(1:iendst(reslib))
|
|---|
| 781 | close(lunchg)
|
|---|
| 782 | stop
|
|---|
| 783 | endif
|
|---|
| 784 | endif
|
|---|
| 785 | goto 4
|
|---|
| 786 | 6 write (*,'(4a)')
|
|---|
| 787 | & ' redchg> Cannot find entry: ',cgty,' in library: ',
|
|---|
| 788 | & reslib(1:iendst(reslib))
|
|---|
| 789 | close(lunchg)
|
|---|
| 790 | stop
|
|---|
| 791 |
|
|---|
| 792 | endif
|
|---|
| 793 |
|
|---|
| 794 | 10 write (*,'(4a)')
|
|---|
| 795 | & ' redchg> Do not have charges for N/C-terminal residue ',
|
|---|
| 796 | & res,' modified with group :',sbrs
|
|---|
| 797 | stop
|
|---|
| 798 |
|
|---|
| 799 | end
|
|---|
| 800 |
|
|---|
