[bd2278d] | 1 | ! **************************************************************
|
---|
| 2 | !
|
---|
| 3 | !
|
---|
| 4 | ! This file contains the subroutines: addend, redchg, rplgrp
|
---|
| 5 | !
|
---|
| 6 | ! Copyright 2003-2005 Frank Eisenmenger, U.H.E. Hansmann,
|
---|
| 7 | ! Shura Hayryan, Chin-Ku
|
---|
| 8 | ! Copyright 2007 Frank Eisenmenger, U.H.E. Hansmann,
|
---|
| 9 | ! Jan H. Meinke, Sandipan Mohanty
|
---|
| 10 | !
|
---|
| 11 | ! $Id: addend.f 334 2007-08-07 09:23:59Z meinke $
|
---|
| 12 | ! **************************************************************
|
---|
[e40e335] | 13 | subroutine addend(nml,grpn,grpc)
|
---|
| 14 |
|
---|
[bd2278d] | 15 | ! ..............................................................
|
---|
| 16 | ! PURPOSE: modify terminal residues to complete bonding scheme
|
---|
| 17 | ! with residue 'grpn' at N- and residue 'grpc' at C-terminus
|
---|
| 18 | ! ! need initial co-ordinates for residues to modify
|
---|
| 19 | ! ! for N-terminus: may add only simple groups
|
---|
| 20 | !
|
---|
| 21 | ! CALLS: rplgrp,tolost,redchg
|
---|
| 22 | ! ..............................................................
|
---|
[e40e335] | 23 |
|
---|
| 24 | include 'INCL.H'
|
---|
| 25 |
|
---|
| 26 | character grpn*4,grpc*4
|
---|
| 27 |
|
---|
| 28 | character res*4,rpat*4,sbrs*4,grn*4,grc*4
|
---|
| 29 |
|
---|
[cb47b9c] | 30 | integer nml
|
---|
| 31 |
|
---|
| 32 | integer i, ifirs, ilars
|
---|
| 33 |
|
---|
| 34 | double precision cg
|
---|
[e40e335] | 35 |
|
---|
| 36 | grn = grpn
|
---|
| 37 | call tolost(grn)
|
---|
| 38 | grc = grpc
|
---|
| 39 | call tolost(grc)
|
---|
| 40 |
|
---|
| 41 | if (grn(:3).eq.'ace'.or.grc(:3).eq.'ace'
|
---|
[bd2278d] | 42 | &.or.grn(:3).eq.'nme'.or.grc(:3).eq.'nme') then
|
---|
[e40e335] | 43 |
|
---|
[38d77eb] | 44 | write (logString, '(2a)')
|
---|
| 45 | & ' addend> N-Acetyl (ace) or N-Methylamide (nme)',
|
---|
| 46 | & ' should be put in SEQUENCE file, not added as end groups'
|
---|
[e40e335] | 47 |
|
---|
| 48 | stop
|
---|
| 49 | endif
|
---|
| 50 |
|
---|
[bd2278d] | 51 | ! __________________________________________ N-terminus
|
---|
[e40e335] | 52 | ifirs=irsml1(nml)
|
---|
| 53 | rpat='n '
|
---|
| 54 | res=seq(ifirs)
|
---|
| 55 | call tolost(res)
|
---|
| 56 | if (res(:3).ne.'ace') then
|
---|
| 57 | if (grn(:3).eq.'nh2') then
|
---|
| 58 | if (res(:3).eq.'hyp'.and..not.flex) then
|
---|
| 59 | if(sh2) then
|
---|
| 60 | sbrs='nh2+'
|
---|
| 61 | else
|
---|
[38d77eb] | 62 | write (logString, '(2a)') ' addend> ',
|
---|
[bd2278d] | 63 | & ' No N-terminal Hyp possible with ECEPP/3 dataset'
|
---|
[e40e335] | 64 | stop
|
---|
| 65 | endif
|
---|
| 66 |
|
---|
| 67 | elseif (res(:3).eq.'pro') then
|
---|
| 68 | sbrs='nh1 '
|
---|
| 69 | elseif (res(:3).eq.'gly'.and..not.flex) then
|
---|
| 70 | if (sh2) then
|
---|
| 71 | sbrs='nh2 '
|
---|
| 72 | else
|
---|
| 73 | sbrs='nh2g'
|
---|
| 74 | endif
|
---|
| 75 | else
|
---|
| 76 | sbrs='nh2 '
|
---|
| 77 | endif
|
---|
| 78 |
|
---|
| 79 | elseif (grn.eq.'nh3+') then
|
---|
| 80 | if (res(:3).eq.'pro'.and..not.flex) then
|
---|
| 81 | sbrs='nh2+'
|
---|
| 82 | elseif (res(:3).eq.'gly'.and..not.flex) then
|
---|
| 83 | sbrs='nh3g'
|
---|
| 84 | else
|
---|
| 85 | sbrs='nh3+'
|
---|
| 86 | endif
|
---|
| 87 |
|
---|
| 88 | else
|
---|
| 89 |
|
---|
[38d77eb] | 90 | write (logString, '(2a)') ' addend> Can add only ',
|
---|
[bd2278d] | 91 | & 'nh2 or nh3+ to N-terminus'
|
---|
[e40e335] | 92 | stop
|
---|
| 93 |
|
---|
| 94 | endif
|
---|
| 95 |
|
---|
| 96 | call rplgrp(nml,ifirs,rpat,sbrs)
|
---|
| 97 | if (flex) call redchg(nml,ifirs,rpat,sbrs) ! Flex dataset
|
---|
| 98 |
|
---|
| 99 | else ! ace
|
---|
| 100 |
|
---|
[38d77eb] | 101 | write (logString, '(2a)') ' addend> Acetyl group',
|
---|
[bd2278d] | 102 | & ' at N-terminus not modified'
|
---|
[e40e335] | 103 | endif
|
---|
| 104 |
|
---|
[bd2278d] | 105 | ! __________________________________________ C-terminus
|
---|
[e40e335] | 106 | ilars=irsml2(nml)
|
---|
| 107 | rpat='c '
|
---|
| 108 | res=seq(ilars)
|
---|
| 109 | call tolost(res)
|
---|
| 110 |
|
---|
| 111 | if (res(:3).ne.'nme') then
|
---|
| 112 |
|
---|
| 113 | if (grc.eq.'cooh') then
|
---|
| 114 |
|
---|
| 115 | if (res(:3).eq.'gly'.and..not.sh2) then
|
---|
| 116 | sbrs='gooh'
|
---|
| 117 | else
|
---|
| 118 | sbrs='cooh'
|
---|
| 119 | endif
|
---|
| 120 |
|
---|
| 121 | elseif (grc.eq.'coo-') then
|
---|
| 122 |
|
---|
| 123 | if (res(:3).eq.'gly'.and..not.sh2) then
|
---|
| 124 | sbrs='goo-'
|
---|
| 125 | else
|
---|
| 126 | sbrs='coo-'
|
---|
| 127 | endif
|
---|
| 128 |
|
---|
| 129 | else
|
---|
| 130 |
|
---|
[38d77eb] | 131 | write (logString, '(2a)') ' addend> Can add only ',
|
---|
[bd2278d] | 132 | & 'cooh or coo- to C-terminus'
|
---|
[e40e335] | 133 | stop
|
---|
| 134 |
|
---|
| 135 | endif
|
---|
| 136 |
|
---|
| 137 | call rplgrp(nml,ilars,rpat,sbrs)
|
---|
| 138 | if (flex) call redchg(nml,ilars,rpat,sbrs) ! Flex dataset
|
---|
| 139 |
|
---|
| 140 | else ! N'-methylamide
|
---|
| 141 |
|
---|
[38d77eb] | 142 | write (logString, '(2a)') ' addend> N-Methylamide',
|
---|
[bd2278d] | 143 | & ' at C-terminus not modified'
|
---|
[e40e335] | 144 |
|
---|
| 145 | endif
|
---|
| 146 |
|
---|
[bd2278d] | 147 | ! ----------------------------- net charge of molecule
|
---|
[e40e335] | 148 | cg = 0.d0
|
---|
| 149 | do i=iatrs1(irsml1(nml)),iatrs2(irsml2(nml))
|
---|
| 150 | cg = cg + cgat(i)
|
---|
| 151 | enddo
|
---|
[38d77eb] | 152 | if (abs(cg).gt.1.d-5) then
|
---|
| 153 | write (logString, '(a,i2,a,f7.3)')
|
---|
| 154 | & ' addend> Net charge of molecule #'
|
---|
[bd2278d] | 155 | & ,nml,': ',cg
|
---|
[38d77eb] | 156 | endif
|
---|
[e40e335] | 157 |
|
---|
| 158 | return
|
---|
| 159 | end
|
---|
[bd2278d] | 160 | ! ****************************************
|
---|
[e40e335] | 161 | subroutine rplgrp(nml,nrs,rpat,sbrs)
|
---|
| 162 |
|
---|
[bd2278d] | 163 | ! ...............................................................
|
---|
| 164 | ! PURPOSE: replace atom(s) rooted at atom 'rpat' in residue
|
---|
| 165 | ! 'nrs' of molecule 'nml' by atom(s) rooted at
|
---|
| 166 | ! 'rpat' of residue 'sbrs' (same name of root
|
---|
| 167 | ! atom 'rpat' maintains bonding geometry for
|
---|
| 168 | ! preceeding atoms in 'nrs')
|
---|
| 169 | !
|
---|
| 170 | ! is NOT performed if 'rpat' is within mainchain,
|
---|
| 171 | ! except it is first/last mainchain atom of 'nml'
|
---|
| 172 | !
|
---|
| 173 | ! CALLS: dihedr,iopfil,iendst,eyring,fndbrn,redres,setsys,valang
|
---|
| 174 | ! ...............................................................
|
---|
[e40e335] | 175 |
|
---|
| 176 | include 'INCL.H'
|
---|
| 177 |
|
---|
| 178 | character rpat*4,sbrs*4
|
---|
| 179 | logical ntbb,bb
|
---|
[cb47b9c] | 180 | integer nml, nrs, ibd, iybd
|
---|
[e40e335] | 181 |
|
---|
| 182 | dimension ibd(mxbd+1),iybd(mxbd+1)
|
---|
[cb47b9c] | 183 |
|
---|
| 184 | integer iopfil, iendst
|
---|
| 185 |
|
---|
| 186 | double precision valang, dihedr
|
---|
| 187 |
|
---|
| 188 | integer ish, i, i1, irng1, irng2, ilavr, ilaat, i2, i3, ibdrg,
|
---|
| 189 | & ib, iat, ifirs, ifivr, ii, iow, isgbb1, ity, nfi, ilars,
|
---|
| 190 | & ivrrp, ivrsb, jsh, j, iybdrg, k, lvrrp, nb, natsb, nla,
|
---|
| 191 | & nfirp, nxt, nsb, nlarp, nfisb, nlasb, nrp, nsh,
|
---|
| 192 | & nvrsb, nxtbb1, nxtbb2, nxtsb
|
---|
| 193 | double precision ba, ca, ct, dx, dz, h3, h2, sa, st,to, x1, x2,
|
---|
| 194 | & x3, y1, y2, y3, z1, z2, z3
|
---|
| 195 |
|
---|
[e40e335] | 196 | ifirs=irsml1(nml)
|
---|
| 197 | ilars=irsml2(nml)
|
---|
| 198 |
|
---|
| 199 | nxt=ixatrs(nrs)
|
---|
| 200 | nfi=iatrs1(nrs)
|
---|
| 201 | nla=iatrs2(nrs)
|
---|
[bd2278d] | 202 | ! __________________________ indices of atoms to be replaced
|
---|
[e40e335] | 203 | do i=nfi,nla
|
---|
| 204 | if (rpat.eq.nmat(i)) then
|
---|
| 205 | nfirp=i
|
---|
| 206 | goto 1
|
---|
| 207 | endif
|
---|
| 208 | enddo
|
---|
[38d77eb] | 209 | write (logString, '(4a,i4,a,i4)') ' rplgrp> cannot find atom >',
|
---|
| 210 | & rpat,
|
---|
| 211 | & '< to be replaced in residue ',seq(nrs),nrs,' of molecule ',nml
|
---|
[e40e335] | 212 | stop
|
---|
| 213 |
|
---|
| 214 | 1 call fndbrn(nml,nrs,nfirp,nlarp,irng1,irng2,bb)
|
---|
| 215 | if (irng1.gt.0) goto 10
|
---|
| 216 | ntbb=.false.
|
---|
| 217 |
|
---|
| 218 | if (bb) then ! ..... backbone
|
---|
| 219 |
|
---|
| 220 | if (nfirp.eq.nxt.and.nrs.eq.ilars) goto 2 ! last mainchain atom
|
---|
| 221 |
|
---|
| 222 | if (nfirp.eq.nfi.and.nrs.eq.ifirs) then ! 1st MAINCHAIN ATOM !
|
---|
| 223 |
|
---|
| 224 | ntbb=.true.
|
---|
| 225 |
|
---|
| 226 | ibd(1)=iowat(nfirp)
|
---|
| 227 | iybd(1)=iyowat(nfirp)
|
---|
| 228 |
|
---|
| 229 | do i=1,mxbd
|
---|
| 230 | ibd(i+1)=ibdat(i,nfirp)
|
---|
| 231 | iybd(i+1)=iybdat(i,nfirp)
|
---|
| 232 | enddo
|
---|
| 233 |
|
---|
| 234 | ibdrg=0 ! __________________ check ring
|
---|
| 235 | iybdrg=1
|
---|
| 236 |
|
---|
| 237 | do i=1,nbdat(nfirp)+1
|
---|
| 238 | if (iowat(ibd(i)).ne.nfirp) then
|
---|
| 239 | if (ibdrg.ne.0) then
|
---|
[38d77eb] | 240 | write (logString, '(2a,i3)')
|
---|
[bd2278d] | 241 | & ' rplgrp> Can handle only simple ring at 1st',
|
---|
| 242 | & ' atom of molecule #',nml
|
---|
[e40e335] | 243 | stop
|
---|
| 244 | endif
|
---|
| 245 | ibdrg=ibd(i)
|
---|
| 246 | iybdrg=iybd(i)
|
---|
| 247 | endif
|
---|
| 248 | enddo
|
---|
| 249 | nxtbb1=nlarp+1 ! _________________ next backbone atoms
|
---|
| 250 | isgbb1=iyowat(nxtbb1)
|
---|
| 251 |
|
---|
| 252 | if (nxtbb1.eq.nxt) then
|
---|
| 253 | if (nrs.lt.ilars) then
|
---|
| 254 | nxtbb2=iatrs1(nrs+1)
|
---|
| 255 | goto 3
|
---|
| 256 | endif
|
---|
| 257 | else
|
---|
| 258 | do i=nxt,nxtbb1+1,-1
|
---|
| 259 | if (iowat(i).eq.nxtbb1) then
|
---|
| 260 | nxtbb2=i
|
---|
| 261 | goto 3
|
---|
| 262 | endif
|
---|
| 263 | enddo
|
---|
| 264 | endif
|
---|
| 265 | goto 11
|
---|
| 266 | else
|
---|
[38d77eb] | 267 | write (logString, '(4a,i4,a,i4)')
|
---|
[bd2278d] | 268 | & ' rplgrp> Cannot replace BACKBONE atom ',rpat,
|
---|
| 269 | & ' of residue ',seq(nrs),nrs,' in molecule #',nml
|
---|
[e40e335] | 270 | stop
|
---|
| 271 | endif
|
---|
| 272 |
|
---|
| 273 | endif ! N-terminus
|
---|
[bd2278d] | 274 | ! _________________________________ previous atoms
|
---|
[e40e335] | 275 | 2 if (nfirp.eq.nfi.and.nrs.eq.ifirs) goto 11
|
---|
| 276 | nxtbb1=iowat(nfirp)
|
---|
| 277 | if (nxtbb1.eq.nfi.and.nrs.eq.ifirs) goto 11
|
---|
| 278 | nxtbb2=iowat(nxtbb1)
|
---|
[bd2278d] | 279 | ! _______________________________ get data for substituent atoms
|
---|
[e40e335] | 280 | 3 if (iopfil(lunlib,reslib,'old','formatted').le.izero) then
|
---|
[38d77eb] | 281 | write (logString, '(a,/,a,i3,2a)')
|
---|
[bd2278d] | 282 | & ' rplgrp> ERROR opening library of residues:',
|
---|
| 283 | & ' LUN=',lunlib,' FILE=',reslib(1:iendst(reslib))
|
---|
[e40e335] | 284 | stop
|
---|
| 285 | endif
|
---|
| 286 | call redres(sbrs,natsb,nxtsb,nvrsb)
|
---|
| 287 | close (lunlib)
|
---|
[bd2278d] | 288 | ! __________________________ indices of substituent atoms
|
---|
[e40e335] | 289 | do i=1,natsb
|
---|
| 290 | if (rpat.eq.nmath(i)) then
|
---|
| 291 | nfisb=i
|
---|
| 292 | goto 4
|
---|
| 293 | endif
|
---|
| 294 | enddo
|
---|
[38d77eb] | 295 | write (logString, '(4a)') ' rplgrp> Cannot find atom >',rpat,
|
---|
[bd2278d] | 296 | &'< in substituent residue ',sbrs
|
---|
[e40e335] | 297 | stop
|
---|
| 298 |
|
---|
| 299 | 4 nlasb=nfisb
|
---|
| 300 | do i=1,nbdath(nfisb)
|
---|
| 301 | ib=ibdath(i,nfisb)
|
---|
| 302 | if (iowath(ib).lt.nfisb) goto 10
|
---|
| 303 | do j=ib,natsb
|
---|
| 304 | if (j.gt.ib.and.iowath(j).lt.ib) goto 5
|
---|
| 305 | do k=1,nbdath(j)
|
---|
| 306 | if (ibdath(k,j).lt.nfisb) goto 10
|
---|
| 307 | enddo
|
---|
| 308 | nlasb=j
|
---|
| 309 | enddo ! ... branch atoms
|
---|
| 310 | 5 enddo ! ... branches
|
---|
[bd2278d] | 311 | ! _________________________________________________ local axes at 'nfirp'
|
---|
[e40e335] | 312 | call setsys(nxtbb1,nfirp,nxtbb2,x1,x2,x3,y1,y2,y3,z1,z2,z3)
|
---|
| 313 |
|
---|
| 314 | xtoat(nfirp)=x1
|
---|
| 315 | ytoat(nfirp)=x2
|
---|
| 316 | ztoat(nfirp)=x3
|
---|
| 317 | xbaat(nfirp)=z1
|
---|
| 318 | ybaat(nfirp)=z2
|
---|
| 319 | zbaat(nfirp)=z3
|
---|
| 320 |
|
---|
[bd2278d] | 321 | ! _____________________ add virtual atoms
|
---|
[e40e335] | 322 | if (ntbb) then
|
---|
| 323 |
|
---|
| 324 | ct=cstoat(nxtbb2) ! t.angle_(+2)
|
---|
| 325 | st=sntoat(nxtbb2)
|
---|
| 326 | ca=csbaat(nxtbb1) ! b.angle_(+1)
|
---|
| 327 | sa=snbaat(nxtbb1)
|
---|
| 328 |
|
---|
[bd2278d] | 329 | ! ------------------- Eyring
|
---|
[e40e335] | 330 | h2=-sa*ct
|
---|
| 331 | h3=-sa*st
|
---|
| 332 | x1=-ca*x1+h2*y1+h3*z1
|
---|
| 333 | x2=-ca*x2+h2*y2+h3*z2
|
---|
| 334 | x3=-ca*x3+h2*y3+h3*z3
|
---|
| 335 | dx=one/sqrt(x1*x1+x2*x2+x3*x3)
|
---|
| 336 | x1=x1*dx
|
---|
| 337 | x2=x2*dx
|
---|
| 338 | x3=x3*dx
|
---|
| 339 |
|
---|
| 340 | xat(izero)=xat(nfirp)+x1
|
---|
| 341 | yat(izero)=yat(nfirp)+x2
|
---|
| 342 | zat(izero)=zat(nfirp)+x3
|
---|
| 343 | z1=-st*y1+ct*z1
|
---|
| 344 | z2=-st*y2+ct*z2
|
---|
| 345 | z3=-st*y3+ct*z3
|
---|
| 346 | dz=one/sqrt(z1*z1+z2*z2+z3*z3)
|
---|
| 347 | z1=z1*dz
|
---|
| 348 | z2=z2*dz
|
---|
| 349 | z3=z3*dz
|
---|
| 350 |
|
---|
| 351 | ct=cstoat(nxtbb1) ! t.angle_(+1)
|
---|
| 352 | st=sntoat(nxtbb1)
|
---|
| 353 |
|
---|
[bd2278d] | 354 | ! -------------------- Eyring with b.angle = 90 deg.
|
---|
[e40e335] | 355 | xat(-ione)=xat(izero)-ct*(z2*x3-z3*x2)-st*z1
|
---|
| 356 | yat(-ione)=yat(izero)-ct*(z3*x1-z1*x3)-st*z2
|
---|
| 357 | zat(-ione)=zat(izero)-ct*(z1*x2-z2*x1)-st*z3
|
---|
| 358 |
|
---|
| 359 | endif
|
---|
[bd2278d] | 360 | ! _____________________________________________ Shift atom data
|
---|
[e40e335] | 361 | nrp=nlarp-nfirp
|
---|
| 362 | nsb=nlasb-nfisb
|
---|
| 363 | if (nrp.ne.nsb) then
|
---|
| 364 | nsh=nsb-nrp
|
---|
| 365 | do i=nfi,nfirp-1 ! bonds to atoms after repl. group
|
---|
| 366 | do j=1,mxbd
|
---|
| 367 | ib=ibdat(j,i)
|
---|
| 368 | if (ib.gt.nlarp.and.ib.le.nla) ibdat(j,i)=ib+nsh
|
---|
| 369 | enddo
|
---|
| 370 | enddo
|
---|
| 371 | ilaat=iatrs2(irsml2(ntlml))
|
---|
| 372 | if (nrp.gt.nsb) then ! less atoms
|
---|
| 373 | i1=nlarp+1
|
---|
| 374 | i2=ilaat
|
---|
| 375 | i3=1
|
---|
| 376 | else ! more atoms
|
---|
| 377 | if ((ilaat+nsh).gt.mxat) then
|
---|
[38d77eb] | 378 | write (logString, '(a,i5)') ' rplgrp> number of atoms > ',
|
---|
| 379 | & mxat
|
---|
[e40e335] | 380 | stop
|
---|
| 381 | endif
|
---|
| 382 |
|
---|
| 383 | i1=ilaat
|
---|
| 384 | i2=nlarp+1
|
---|
| 385 | i3=-1
|
---|
| 386 | endif
|
---|
| 387 |
|
---|
| 388 | do i=i1,i2,i3
|
---|
| 389 | ii=i+nsh
|
---|
| 390 | nbdat(ii)=nbdat(i)
|
---|
| 391 |
|
---|
| 392 | ibd(1)=iowat(i)
|
---|
| 393 | iybd(1)=iyowat(i)
|
---|
| 394 | do j = 1,mxbd
|
---|
| 395 | ibd(j+1)=ibdat(j,i)
|
---|
| 396 | iybd(j+1)=iybdat(j,i)
|
---|
| 397 | enddo
|
---|
| 398 |
|
---|
| 399 | do j=1,mxbd+1
|
---|
| 400 | if (ibd(j).gt.nfirp) ibd(j)=ibd(j)+nsh
|
---|
| 401 | enddo
|
---|
| 402 |
|
---|
| 403 | iowat(ii)=ibd(1)
|
---|
| 404 | iyowat(ii)=iybd(1)
|
---|
| 405 | do j = 1,mxbd
|
---|
| 406 | ibdat(j,ii)=ibd(j+1)
|
---|
| 407 | iybdat(j,ii)=iybd(j+1)
|
---|
| 408 | enddo
|
---|
| 409 |
|
---|
| 410 | ityat(ii)=ityat(i)
|
---|
| 411 | nmat(ii)=nmat(i)
|
---|
| 412 | cgat(ii)=cgat(i)
|
---|
| 413 | blat(ii)=blat(i)
|
---|
| 414 | baat(ii)=baat(i)
|
---|
| 415 | snbaat(ii)=snbaat(i)
|
---|
| 416 | csbaat(ii)=csbaat(i)
|
---|
| 417 | toat(ii)=toat(i)
|
---|
| 418 | sntoat(ii)=sntoat(i)
|
---|
| 419 | cstoat(ii)=cstoat(i)
|
---|
| 420 | xat(ii)=xat(i)
|
---|
| 421 | yat(ii)=yat(i)
|
---|
| 422 | zat(ii)=zat(i)
|
---|
| 423 | xtoat(ii)=xtoat(i)
|
---|
| 424 | ytoat(ii)=ytoat(i)
|
---|
| 425 | ztoat(ii)=ztoat(i)
|
---|
| 426 | xbaat(ii)=xbaat(i)
|
---|
| 427 | ybaat(ii)=ybaat(i)
|
---|
| 428 | zbaat(ii)=zbaat(i)
|
---|
| 429 |
|
---|
| 430 | enddo
|
---|
[bd2278d] | 431 | ! ____________________________________________ Shift residue data
|
---|
[e40e335] | 432 | do i=nrs+1,irsml2(ntlml)
|
---|
| 433 | iatrs1(i)=iatrs1(i)+nsh
|
---|
| 434 | iatrs2(i)=iatrs2(i)+nsh
|
---|
| 435 | ixatrs(i)=ixatrs(i)+nsh
|
---|
| 436 | enddo
|
---|
| 437 | iatrs2(nrs)=nla+nsh
|
---|
| 438 | if (nxt.gt.nlarp) ixatrs(nrs)=nxt+nsh
|
---|
| 439 | else
|
---|
| 440 | nsh=0
|
---|
| 441 | endif
|
---|
[bd2278d] | 442 | ! _________________________________________ Correct data of 'nfirp'
|
---|
[e40e335] | 443 | ish=nfirp-nfisb
|
---|
| 444 | ityat(nfirp)=ityath(nfisb)
|
---|
| 445 |
|
---|
| 446 | if(.not.sh2) cgat(nfirp)=cgath(nfisb) ! NOT for 'ECEPP/2'
|
---|
| 447 |
|
---|
| 448 | nb=nbdath(nfisb) ! _______________ Bonds
|
---|
| 449 |
|
---|
| 450 | do i=1,mxbd
|
---|
| 451 | ib=ibdath(i,nfisb)
|
---|
| 452 | if (ib.ne.0) then
|
---|
| 453 | ibd(i)=ib+ish
|
---|
| 454 | iybd(i)=iybdath(i,nfisb)
|
---|
| 455 | else
|
---|
| 456 | ibd(i)=0
|
---|
| 457 | iybd(i)=1
|
---|
| 458 | endif
|
---|
| 459 |
|
---|
| 460 | enddo
|
---|
| 461 |
|
---|
| 462 | if (ntbb) then
|
---|
| 463 |
|
---|
| 464 | ibd(mxbd+1)=0
|
---|
| 465 | iybd(mxbd+1)=1
|
---|
| 466 |
|
---|
| 467 | ibd(nb+1)=nxtbb1+nsh ! bond to next backbone atom
|
---|
| 468 | iybd(nb+1)=isgbb1
|
---|
| 469 |
|
---|
| 470 | if (ibdrg.ne.0) then
|
---|
| 471 | nb=nb+1
|
---|
| 472 | if (nb.gt.mxbd) then
|
---|
[38d77eb] | 473 | write (logString, '(6a,/,2a,3(i4,a))')
|
---|
[bd2278d] | 474 | & ' rplgrp> Cannot add atoms following ',rpat,
|
---|
| 475 | & ' from group ',sbrs,' to atom ',rpat,
|
---|
| 476 | & ' of residue ',seq(nrs),nrs,' in molecule #',nml,
|
---|
| 477 | & ' because need >',(mxbd+1),' bonds'
|
---|
[e40e335] | 478 | stop
|
---|
| 479 | endif
|
---|
| 480 | ibd(nb+1)=ibdrg+nsh
|
---|
| 481 | iybd(nb+1)=iybdrg
|
---|
| 482 | endif
|
---|
| 483 | iowat(nfirp)=ibd(1)
|
---|
| 484 | iyowat(nfirp)=iybd(1)
|
---|
| 485 | do i=1,mxbd
|
---|
| 486 | ibdat(i,nfirp)=ibd(i+1)
|
---|
| 487 | iybdat(i,nfirp)=iybd(i+1)
|
---|
| 488 | enddo
|
---|
| 489 | else ! not 'ntbb'
|
---|
| 490 |
|
---|
| 491 | do i=1,mxbd
|
---|
| 492 | ibdat(i,nfirp)=ibd(i)
|
---|
| 493 | iybdat(i,nfirp)=iybd(i)
|
---|
| 494 | enddo
|
---|
| 495 |
|
---|
| 496 | endif
|
---|
| 497 | nbdat(nfirp)=nb
|
---|
[bd2278d] | 498 | ! _________________________________________ Add data for substituent
|
---|
[e40e335] | 499 | ii=nfirp
|
---|
| 500 | do i=nfisb+1,nlasb
|
---|
| 501 | ii=ii+1
|
---|
| 502 | nbdat(ii)=nbdath(i)
|
---|
| 503 |
|
---|
| 504 | iow=iowath(i)+ish
|
---|
| 505 | iowat(ii)=iow
|
---|
| 506 | iyowat(ii)=iyowath(i)
|
---|
| 507 |
|
---|
| 508 | do j=1,mxbd
|
---|
| 509 | ib=ibdath(j,i)
|
---|
| 510 | if (ib.ge.nfisb) then
|
---|
| 511 | ibdat(j,ii)=ib+ish
|
---|
| 512 | else
|
---|
| 513 | ibdat(j,ii)=ib
|
---|
| 514 | endif
|
---|
| 515 | iybdat(j,ii)=iybdath(j,i)
|
---|
| 516 | enddo
|
---|
| 517 |
|
---|
| 518 | ityat(ii)=ityath(i)
|
---|
| 519 | nmat(ii)=nmath(i)
|
---|
| 520 | cgat(ii)=cgath(i)
|
---|
| 521 | blat(ii)=blath(i)
|
---|
| 522 | ba=baath(i)
|
---|
| 523 | baat(ii)=ba
|
---|
| 524 | csbaat(ii)=cos(ba)
|
---|
| 525 | snbaat(ii)=sin(ba)
|
---|
| 526 | to=toath(i)
|
---|
| 527 | toat(ii)=to
|
---|
| 528 | cstoat(ii)=cos(to)
|
---|
| 529 | sntoat(ii)=sin(to)
|
---|
| 530 | call eyring(ii,iow)
|
---|
| 531 | if (ntbb) then ! reset some internal coordinates
|
---|
| 532 | if (iow.eq.nfirp) then
|
---|
| 533 | ba=valang(izero,nfirp,ii)
|
---|
| 534 | baat(ii)=ba
|
---|
| 535 | csbaat(ii)=cos(ba)
|
---|
| 536 | snbaat(ii)=sin(ba)
|
---|
| 537 | to=dihedr(-ione,izero,nfirp,ii)
|
---|
| 538 | toat(ii)=to
|
---|
| 539 | cstoat(ii)=cos(to)
|
---|
| 540 | sntoat(ii)=sin(to)
|
---|
| 541 | elseif (iowat(iow).eq.nfirp) then
|
---|
| 542 | to=dihedr(izero,nfirp,iow,ii)
|
---|
| 543 | toat(ii)=to
|
---|
| 544 | cstoat(ii)=cos(to)
|
---|
| 545 | sntoat(ii)=sin(to)
|
---|
| 546 | endif
|
---|
| 547 |
|
---|
| 548 | endif ! ntbb
|
---|
| 549 |
|
---|
| 550 | enddo ! substituent atoms
|
---|
[bd2278d] | 551 | ! ___________________________________________________ Take care of Variables
|
---|
| 552 | ! (assume variables of replaced group/substituent to be stored CONSECUTIVELY)
|
---|
[e40e335] | 553 |
|
---|
| 554 | ilavr=ivrml1(ntlml)+nvrml(ntlml)-1
|
---|
| 555 | ifivr=ivrrs1(nrs) ! variables to be replaced (#=ivrrp,last=lvrrp)
|
---|
| 556 | ivrrp=0
|
---|
| 557 | do i=ifivr,ifivr+nvrrs(nrs)-1
|
---|
| 558 | iat=iatvr(i)
|
---|
| 559 | if (nfirp.lt.iat.and.iat.le.nlarp) then
|
---|
| 560 | ivrrp=ivrrp+1
|
---|
| 561 | lvrrp=i
|
---|
| 562 | endif
|
---|
| 563 | enddo
|
---|
| 564 | if (ivrrp.eq.0) then ! No variables to replace
|
---|
| 565 | do i=ifivr,ilavr
|
---|
| 566 | if (iatvr(i).gt.nlarp) then
|
---|
| 567 | lvrrp=i-1
|
---|
| 568 | goto 6
|
---|
| 569 | endif
|
---|
| 570 | enddo
|
---|
| 571 | lvrrp=ilavr
|
---|
| 572 | endif
|
---|
| 573 | 6 ivrsb=0 ! variables from substituent (#=ivrsb)
|
---|
| 574 | do i=1,nvrsb
|
---|
| 575 | iat=iatvrh(i)
|
---|
| 576 | if (nfisb.lt.iat.and.iat.le.nlasb) then
|
---|
| 577 | ity=ityvrh(i)
|
---|
| 578 | if (ntbb.and.iowath(iat).eq.nfisb.and.ity.gt.2) goto 7
|
---|
| 579 | ivrsb=ivrsb+1
|
---|
| 580 | nmvrh(ivrsb)=nmvrh(i)
|
---|
| 581 | ityvrh(ivrsb)=ityvrh(i)
|
---|
| 582 | iclvrh(ivrsb)=iclvrh(i)
|
---|
| 583 | iatvrh(ivrsb)=iat
|
---|
| 584 | endif
|
---|
| 585 | 7 enddo
|
---|
| 586 | if (nsh.ne.0) then ! if # of atoms changed
|
---|
| 587 | do i=lvrrp+1,ilavr
|
---|
| 588 | iatvr(i)=iatvr(i)+nsh
|
---|
| 589 | enddo
|
---|
| 590 | endif
|
---|
| 591 |
|
---|
| 592 | if (ivrrp.ne.ivrsb) then ! shift data for variables
|
---|
| 593 | jsh=ivrsb-ivrrp
|
---|
| 594 | if (ivrrp.gt.ivrsb) then
|
---|
| 595 | i1=lvrrp+1
|
---|
| 596 | i2=ilavr
|
---|
| 597 | i3=1
|
---|
| 598 | else
|
---|
| 599 | if ((ilavr+jsh).gt.mxvr) then
|
---|
[38d77eb] | 600 | write (logString, '(a,i5)')
|
---|
| 601 | & ' rplgrp> number of variables > ',mxvr
|
---|
[e40e335] | 602 | stop
|
---|
| 603 | endif
|
---|
| 604 | i1=ilavr
|
---|
| 605 | i2=lvrrp+1
|
---|
| 606 | i3=-1
|
---|
| 607 | endif
|
---|
| 608 | do i=i1,i2,i3
|
---|
| 609 | ii=i+jsh
|
---|
| 610 | ityvr(ii)=ityvr(i)
|
---|
| 611 | iclvr(ii)=iclvr(i)
|
---|
| 612 | nmvr(ii)=nmvr(i)
|
---|
| 613 | iatvr(ii)=iatvr(i)
|
---|
| 614 | enddo
|
---|
| 615 |
|
---|
| 616 | do i=nrs+1,irsml2(ntlml)
|
---|
| 617 | ivrrs1(i)=ivrrs1(i)+jsh
|
---|
| 618 | enddo
|
---|
| 619 | nvrrs(nrs)=nvrrs(nrs)+jsh
|
---|
| 620 | nvrml(nml)=nvrml(nml)+jsh
|
---|
| 621 | do i=nml+1,ntlml
|
---|
| 622 | ivrml1(i)=ivrml1(i)+jsh
|
---|
| 623 | enddo
|
---|
| 624 | endif
|
---|
| 625 | ii=lvrrp-ivrrp ! Add variables for substitutent
|
---|
| 626 | do i=1,ivrsb
|
---|
| 627 | ii=ii+1
|
---|
| 628 | nmvr(ii)=nmvrh(i)
|
---|
| 629 | ityvr(ii)=ityvrh(i)
|
---|
| 630 | iclvr(ii)=iclvrh(i)
|
---|
| 631 | iatvr(ii)=iatvrh(i)+ish
|
---|
| 632 | enddo
|
---|
| 633 |
|
---|
| 634 | return
|
---|
[bd2278d] | 635 | ! __________________________________________ Errors
|
---|
[38d77eb] | 636 | 10 write (logString, '(3a,/,2a,i4,a,i4,/,2a)')
|
---|
[bd2278d] | 637 | & ' rplgrp> Cannot replace atom(s) following ',rpat,
|
---|
| 638 | & ' from INSIDE a ring',' in residue: ',seq(nrs),nrs,
|
---|
| 639 | & ' in molecule #',nml,' or in substitute: ',sbrs
|
---|
[e40e335] | 640 | stop
|
---|
[38d77eb] | 641 | 11 write (logString, '(4a,i4,a,i4,/,a)')
|
---|
[bd2278d] | 642 | & ' rplgrp> Cannot replace atom(s) following ',rpat,
|
---|
| 643 | & ' of residue ',seq(nrs),nrs,' in molecule #',nml,
|
---|
| 644 | & ' since necessary 2 previous atoms are not available'
|
---|
[e40e335] | 645 | stop
|
---|
| 646 |
|
---|
| 647 | end
|
---|
[bd2278d] | 648 | ! ****************************************
|
---|
[e40e335] | 649 | subroutine redchg(nml,nrs,rpat,sbrs)
|
---|
| 650 |
|
---|
[bd2278d] | 651 | ! .........................................................
|
---|
| 652 | ! PURPOSE: read and place atomic point charges from residue
|
---|
| 653 | ! 'sbrs' to residue 'nrs' of molecule 'nml'
|
---|
| 654 | ! from library 'chglib' with LUN=lunchg, if ilib=1
|
---|
| 655 | ! 'reslib' with LUN=lunlib, if ilib=2
|
---|
| 656 | !
|
---|
| 657 | ! CALLS: iopfil,iendst,tolost
|
---|
| 658 | ! ........................................................
|
---|
[e40e335] | 659 |
|
---|
| 660 | include 'INCL.H'
|
---|
| 661 |
|
---|
| 662 | character rpat*4,sbrs*4,atnm*4,res*4,cgty*5,line*100
|
---|
[cb47b9c] | 663 | integer nml, nrs
|
---|
| 664 |
|
---|
| 665 | integer iopfil, iendst
|
---|
| 666 |
|
---|
| 667 | integer ifirs, ilars, ifvr, ilib, i, l, j, nchg
|
---|
[e40e335] | 668 |
|
---|
| 669 | ifirs=irsml1(nml)
|
---|
| 670 | ilars=irsml2(nml)
|
---|
| 671 | res=seq(nrs)
|
---|
| 672 | call tolost(res)
|
---|
| 673 |
|
---|
| 674 | if (nrs.eq.ifirs.or.nrs.eq.ilars) then
|
---|
| 675 |
|
---|
| 676 | if (rpat.eq.'n '.or.rpat.eq.'c ') then
|
---|
| 677 | if (nrs.eq.ifirs.and.nrs.eq.ilars) goto 10 ! Dont have this yet
|
---|
| 678 |
|
---|
| 679 | if (rpat.eq.'n '.and.nrs.eq.ifirs) then
|
---|
| 680 | if (res(1:3).eq.'pro'.or.res(1:3).eq.'hyp') then
|
---|
| 681 | if (sbrs.eq.'nh1 ') cgty='n'//res
|
---|
| 682 | if (sbrs.eq.'nh2+') cgty='+'//res
|
---|
| 683 | else
|
---|
| 684 | if (sbrs.eq.'nh2 ') cgty='n'//res
|
---|
| 685 | if (sbrs.eq.'nh3+') cgty='+'//res
|
---|
| 686 | endif
|
---|
| 687 | elseif (rpat.eq.'c '.and.nrs.eq.ilars) then
|
---|
| 688 | if (sbrs.eq.'cooh') cgty='c'//res
|
---|
| 689 | if (sbrs.eq.'coo-') cgty='-'//res
|
---|
| 690 | else
|
---|
| 691 | goto 10
|
---|
| 692 | endif
|
---|
| 693 | else
|
---|
[38d77eb] | 694 | write(logString,*)
|
---|
| 695 | & ' redchg> dont know which end goup is present'
|
---|
[e40e335] | 696 | stop
|
---|
| 697 | endif
|
---|
| 698 | ilib=1
|
---|
| 699 | else
|
---|
| 700 | cgty(1:)=sbrs
|
---|
| 701 | ilib=2
|
---|
| 702 | endif
|
---|
| 703 |
|
---|
| 704 | if (ilib.eq.1) then
|
---|
| 705 |
|
---|
| 706 | if (iopfil(lunchg,chgfil,'old','formatted').le.izero) then
|
---|
[38d77eb] | 707 | write (logString, '(a,/,a,i3,2a)')
|
---|
[bd2278d] | 708 | & ' redchg> ERROR opening library of charges:',
|
---|
| 709 | & ' LUN=',lunchg,' FILE=',chgfil(1:iendst(chgfil))
|
---|
[e40e335] | 710 | stop
|
---|
| 711 | endif
|
---|
| 712 |
|
---|
| 713 | 1 line=' '
|
---|
| 714 | read (lunchg,'(a)',end=3) line
|
---|
| 715 | l=iendst(line)
|
---|
| 716 |
|
---|
| 717 | if (l.ge.10.and.line(1:1).eq.'#'.and.line(2:6).eq.cgty) then
|
---|
| 718 | read (line(7:10),'(i4)') nchg
|
---|
| 719 | if (nchg.le.mxath) then
|
---|
| 720 | read (lunchg,'(10(2x,a4,1x))') (nmath(i),i=1,nchg)
|
---|
| 721 | read (lunchg,'(10(f6.4,1x))') (cgath(i),i=1,nchg)
|
---|
| 722 | close(lunchg)
|
---|
| 723 | do i=iatrs1(nrs),iatrs2(nrs)
|
---|
| 724 | atnm=nmat(i)
|
---|
| 725 | do j=1,nchg
|
---|
| 726 | if (nmath(j).eq.atnm) then
|
---|
| 727 | cgat(i)=cgath(j)
|
---|
| 728 | goto 2
|
---|
| 729 | endif
|
---|
| 730 | enddo
|
---|
[38d77eb] | 731 | write (logString, '(6a)') ' redchg> Cannot find atom: ',
|
---|
| 732 | & atnm,
|
---|
[bd2278d] | 733 | & ' for entry: ',cgty,' in library: ',
|
---|
| 734 | & chgfil(1:iendst(chgfil))
|
---|
[e40e335] | 735 | stop
|
---|
| 736 | 2 enddo
|
---|
| 737 | return
|
---|
| 738 | else
|
---|
[38d77eb] | 739 | write (logString, '(4a)')
|
---|
[bd2278d] | 740 | & ' redchg> must increase MXATH to read data for entry: ',
|
---|
| 741 | & cgty,' in library: ',chgfil(1:iendst(chgfil))
|
---|
[e40e335] | 742 | close(lunchg)
|
---|
| 743 | stop
|
---|
| 744 | endif
|
---|
| 745 | endif
|
---|
| 746 | goto 1
|
---|
[38d77eb] | 747 | 3 write (logString, '(4a)')
|
---|
[bd2278d] | 748 | & ' redchg> Cannot find entry: ',cgty,' in library: ',
|
---|
| 749 | & chgfil(1:iendst(chgfil))
|
---|
[e40e335] | 750 | close(lunchg)
|
---|
| 751 | stop
|
---|
| 752 |
|
---|
| 753 | elseif (ilib.eq.2) then
|
---|
| 754 |
|
---|
| 755 | if (iopfil(lunlib,reslib,'old','formatted').le.izero) then
|
---|
[38d77eb] | 756 | write (logString, '(a,/,a,i3,2a)')
|
---|
[bd2278d] | 757 | & ' redchg> ERROR opening library of residues:',
|
---|
| 758 | & ' LUN=',lunlib,' FILE=',reslib(1:iendst(reslib))
|
---|
[e40e335] | 759 | stop
|
---|
| 760 | endif
|
---|
| 761 |
|
---|
| 762 | 4 line=' '
|
---|
| 763 | read (lunlib,'(a)',end=6) line
|
---|
| 764 | l=iendst(line)
|
---|
| 765 |
|
---|
| 766 | if (l.ge.9.and.line(1:1).eq.'#'.and.line(2:5).eq.cgty(1:4)) then
|
---|
| 767 | read (line(6:9),'(i4)') nchg
|
---|
| 768 | if (nchg.le.mxath) then
|
---|
| 769 | read (lunlib,'(a4,42x,d7.4)') (nmath(i),cgath(i),i=1,nchg)
|
---|
| 770 | close(lunlib)
|
---|
| 771 | do i=iatrs1(nrs),iatrs2(nrs)
|
---|
| 772 | atnm=nmat(i)
|
---|
| 773 | do j=1,nchg
|
---|
| 774 | if (nmath(j).eq.atnm) then
|
---|
| 775 | cgat(i)=cgath(j)
|
---|
| 776 | goto 5
|
---|
| 777 | endif
|
---|
| 778 | enddo
|
---|
[38d77eb] | 779 | write (logString, '(6a)') ' redchg> Cannot find atom: ',
|
---|
| 780 | & atnm,
|
---|
[bd2278d] | 781 | & ' for entry: ',cgty,' in library: ',
|
---|
| 782 | & reslib(1:iendst(reslib))
|
---|
[e40e335] | 783 | stop
|
---|
| 784 | 5 enddo
|
---|
| 785 | return
|
---|
| 786 | else
|
---|
[38d77eb] | 787 | write (logString, '(4a)')
|
---|
[bd2278d] | 788 | & ' redchg> must increase MXATH to read data for entry: ',
|
---|
| 789 | & cgty,' in library: ',reslib(1:iendst(reslib))
|
---|
[e40e335] | 790 | close(lunchg)
|
---|
| 791 | stop
|
---|
| 792 | endif
|
---|
| 793 | endif
|
---|
| 794 | goto 4
|
---|
[38d77eb] | 795 | 6 write (logString, '(4a)')
|
---|
[bd2278d] | 796 | & ' redchg> Cannot find entry: ',cgty,' in library: ',
|
---|
| 797 | & reslib(1:iendst(reslib))
|
---|
[e40e335] | 798 | close(lunchg)
|
---|
| 799 | stop
|
---|
| 800 |
|
---|
| 801 | endif
|
---|
| 802 |
|
---|
[38d77eb] | 803 | 10 write (logString, '(4a)')
|
---|
[bd2278d] | 804 | & ' redchg> Do not have charges for N/C-terminal residue ',
|
---|
| 805 | & res,' modified with group :',sbrs
|
---|
[e40e335] | 806 | stop
|
---|
| 807 |
|
---|
| 808 | end
|
---|
| 809 |
|
---|