| 1 | c **************************************************************
|
|---|
| 2 | c
|
|---|
| 3 | c This file contains the subroutines: pdbread,pdbvars,atixpdb,getpar
|
|---|
| 4 | c
|
|---|
| 5 | c Copyright 2003-2005 Frank Eisenmenger, U.H.E. Hansmann,
|
|---|
| 6 | c Shura Hayryan, Chin-Ku
|
|---|
| 7 | c Copyright 2007 Frank Eisenmenger, U.H.E. Hansmann,
|
|---|
| 8 | c Jan H. Meinke, Sandipan Mohanty
|
|---|
| 9 | c
|
|---|
| 10 | c **************************************************************
|
|---|
| 11 |
|
|---|
| 12 | subroutine pdbread(pdbfil,ier)
|
|---|
| 13 |
|
|---|
| 14 | c ....................................................
|
|---|
| 15 | c PURPOSE: read protein atom coordinates from 'pdbfil'
|
|---|
| 16 | c (no Hydrogens, only ATOM records)
|
|---|
| 17 | c
|
|---|
| 18 | c RETURNS: 0 = no errors / 1 = error
|
|---|
| 19 | c
|
|---|
| 20 | c CALLS: iopfil,iendst
|
|---|
| 21 | c ......................................................
|
|---|
| 22 |
|
|---|
| 23 | implicit real*8 (a-h,o-z)
|
|---|
| 24 | implicit integer*4 (i-n)
|
|---|
| 25 |
|
|---|
| 26 | include 'INCP.H'
|
|---|
| 27 |
|
|---|
| 28 | c -------------------------- input
|
|---|
| 29 | character*(*) pdbfil
|
|---|
| 30 | c -------------------------- local
|
|---|
| 31 | dimension cor(3)
|
|---|
| 32 | character atm*4,rsn*3,rsno*3,chn,chno,
|
|---|
| 33 | # rsid*5,rsido*5,line*132
|
|---|
| 34 |
|
|---|
| 35 | natp=0
|
|---|
| 36 | nchp=0
|
|---|
| 37 | nrsp=0
|
|---|
| 38 |
|
|---|
| 39 | ier=1
|
|---|
| 40 |
|
|---|
| 41 | chno='&'
|
|---|
| 42 | rsno='#&#'
|
|---|
| 43 | rsido='#&#&#'
|
|---|
| 44 |
|
|---|
| 45 | l=iendst(pdbfil)
|
|---|
| 46 | if (l.gt.0) then
|
|---|
| 47 | lunpdb = 99
|
|---|
| 48 | else
|
|---|
| 49 | write (*,'(a)')
|
|---|
| 50 | # ' pdbread> empty file name to read pdb-structure'
|
|---|
| 51 |
|
|---|
| 52 | return
|
|---|
| 53 | endif
|
|---|
| 54 |
|
|---|
| 55 | io=iopfil(lunpdb,pdbfil,'old','formatted')
|
|---|
| 56 |
|
|---|
| 57 | if (io.le.0) then
|
|---|
| 58 | write (*,'(a,/,a)')
|
|---|
| 59 | # ' pdbread> ERROR opening file to read pdb-structure: ',
|
|---|
| 60 | # pdbfil(1:iendst(pdbfil))
|
|---|
| 61 |
|
|---|
| 62 | return
|
|---|
| 63 | endif
|
|---|
| 64 |
|
|---|
| 65 | 1 read (lunpdb,'(a)',end=3,err=2) line
|
|---|
| 66 | l=iendst(line)
|
|---|
| 67 |
|
|---|
| 68 | if (l.lt.54.or.index(line(1:4),'ATOM').le.0) goto 1
|
|---|
| 69 |
|
|---|
| 70 | if ( line(17:17).ne.' ' ) then
|
|---|
| 71 | write (*,'(a,/,a,/,a,/,2a)')
|
|---|
| 72 | # ' pdbread> found alternate atom location: ',
|
|---|
| 73 | # ' !',
|
|---|
| 74 | # line(:l),' in file: ',pdbfil(1:iendst(pdbfil))
|
|---|
| 75 |
|
|---|
| 76 | close(lunpdb)
|
|---|
| 77 | return
|
|---|
| 78 | endif
|
|---|
| 79 |
|
|---|
| 80 | atm=line(13:16)
|
|---|
| 81 |
|
|---|
| 82 | if (index(atm(2:2),'H').gt.0) goto 1 ! no H
|
|---|
| 83 |
|
|---|
| 84 | read(line,10,err=2) iat,rsn,chn,rsid,(cor(i),i=1,3)
|
|---|
| 85 |
|
|---|
| 86 | if ((natp+1).gt.MXATP) then
|
|---|
| 87 | write (*,'(a,i5,a,/,a)')
|
|---|
| 88 | # ' pdbread> >MXATP (',MXATP,') ATOM lines in PDB file ',
|
|---|
| 89 | # pdbfil(1:iendst(pdbfil))
|
|---|
| 90 |
|
|---|
| 91 | close(lunpdb)
|
|---|
| 92 | return
|
|---|
| 93 | endif
|
|---|
| 94 |
|
|---|
| 95 | if (chn.ne.chno) then ! new chain
|
|---|
| 96 |
|
|---|
| 97 | if ((nchp+1).gt.MXCHP) then
|
|---|
| 98 | write (*,'(a,i3,a,/,a)')
|
|---|
| 99 | # ' pdbread> >MXCHP (',MXCHP,') chains in PDB file ',
|
|---|
| 100 | # pdbfil(1:iendst(pdbfil))
|
|---|
| 101 |
|
|---|
| 102 | close(lunpdb)
|
|---|
| 103 | return
|
|---|
| 104 | endif
|
|---|
| 105 |
|
|---|
| 106 | if ((nrsp+1).gt.MXRSP) then
|
|---|
| 107 | write (*,'(a,i3,a,/,a)')
|
|---|
| 108 | # ' pdbread> >MXRSP (',MXRSP,') residues in PDB file ',
|
|---|
| 109 | # pdbfil(1:iendst(pdbfil))
|
|---|
| 110 |
|
|---|
| 111 | close(lunpdb)
|
|---|
| 112 | return
|
|---|
| 113 | endif
|
|---|
| 114 |
|
|---|
| 115 | if (nchp.eq.1) then
|
|---|
| 116 | nchrsp(nchp)=nrsp
|
|---|
| 117 | elseif (nchp.gt.1) then
|
|---|
| 118 | nchrsp(nchp)=nrsp-nchrsp(nchp)
|
|---|
| 119 | endif
|
|---|
| 120 |
|
|---|
| 121 | nchp=nchp+1
|
|---|
| 122 | chno=chn
|
|---|
| 123 | chnp(nchp)=chn
|
|---|
| 124 |
|
|---|
| 125 | nchrsp(nchp)=nrsp ! -1 1st res.
|
|---|
| 126 |
|
|---|
| 127 | if (nrsp.ge.1) then
|
|---|
| 128 | nrsatp(nrsp)=natp-irsatp(nrsp)+1
|
|---|
| 129 | endif
|
|---|
| 130 |
|
|---|
| 131 | rsido=rsid
|
|---|
| 132 | rsno=rsn
|
|---|
| 133 |
|
|---|
| 134 | nrsp=nrsp+1
|
|---|
| 135 | irsatp(nrsp)=natp+1
|
|---|
| 136 | rsnmp(nrsp)=rsn
|
|---|
| 137 | rsidp(nrsp)=rsid
|
|---|
| 138 |
|
|---|
| 139 | elseif (rsid.ne.rsido.or.rsn.ne.rsno) then ! new residue
|
|---|
| 140 |
|
|---|
| 141 | if ((nrsp+1).gt.MXRSP) then
|
|---|
| 142 | write (*,'(a,i3,a,/,a)')
|
|---|
| 143 | # ' pdbread> >MXRSP (',MXRSP,') residues in PDB file ',
|
|---|
| 144 | # pdbfil(1:iendst(pdbfil))
|
|---|
| 145 |
|
|---|
| 146 | close(lunpdb)
|
|---|
| 147 | return
|
|---|
| 148 | endif
|
|---|
| 149 |
|
|---|
| 150 | nrsatp(nrsp)=natp-irsatp(nrsp)+1
|
|---|
| 151 |
|
|---|
| 152 | rsido=rsid
|
|---|
| 153 | rsno=rsn
|
|---|
| 154 |
|
|---|
| 155 | nrsp=nrsp+1
|
|---|
| 156 | irsatp(nrsp)=natp+1
|
|---|
| 157 | rsnmp(nrsp)=rsn
|
|---|
| 158 | rsidp(nrsp)=rsid
|
|---|
| 159 |
|
|---|
| 160 | endif
|
|---|
| 161 |
|
|---|
| 162 | natp=natp+1
|
|---|
| 163 |
|
|---|
| 164 | noatp(natp)=iat
|
|---|
| 165 | atnmp(natp)=atm
|
|---|
| 166 |
|
|---|
| 167 | xatp(natp)=cor(1)
|
|---|
| 168 | yatp(natp)=cor(2)
|
|---|
| 169 | zatp(natp)=cor(3)
|
|---|
| 170 |
|
|---|
| 171 | goto 1
|
|---|
| 172 |
|
|---|
| 173 | 2 write (*,'(a,/,a,/,2a)')
|
|---|
| 174 | # ' pdbread> ERROR reading ATOM line ',
|
|---|
| 175 | # line(:l),
|
|---|
| 176 | # ' from file ',pdbfil(1:iendst(pdbfil))
|
|---|
| 177 |
|
|---|
| 178 | close(lunpdb)
|
|---|
| 179 | return
|
|---|
| 180 |
|
|---|
| 181 | 3 close(lunpdb)
|
|---|
| 182 |
|
|---|
| 183 | if (natp.gt.0) then
|
|---|
| 184 |
|
|---|
| 185 | if (nchp.eq.1) then
|
|---|
| 186 | nchrsp(nchp)=nrsp
|
|---|
| 187 | elseif (nchp.gt.1) then
|
|---|
| 188 | nchrsp(nchp)=nrsp-nchrsp(nchp)
|
|---|
| 189 | endif
|
|---|
| 190 |
|
|---|
| 191 | nrsatp(nrsp)=natp-irsatp(nrsp)+1
|
|---|
| 192 | ier=0
|
|---|
| 193 |
|
|---|
| 194 | else
|
|---|
| 195 |
|
|---|
| 196 | write (*,'(a,/,a)')
|
|---|
| 197 | # ' pdbread> NO atom coordinates selected from file ',
|
|---|
| 198 | # pdbfil(1:iendst(pdbfil))
|
|---|
| 199 |
|
|---|
| 200 | endif
|
|---|
| 201 |
|
|---|
| 202 | return
|
|---|
| 203 |
|
|---|
| 204 | 10 format(6x,i5,6x,a3,1x,a1,a5,3x,3d8.3)
|
|---|
| 205 |
|
|---|
| 206 | end
|
|---|
| 207 | c **************************************************************
|
|---|
| 208 |
|
|---|
| 209 | subroutine pdbvars()
|
|---|
| 210 |
|
|---|
| 211 | c --------------------------------------------------------------------
|
|---|
| 212 | c PURPOSE: sequence,indices for selected atoms (data in INCP.H)
|
|---|
| 213 | c & torsions from PDB to be used to build SMMP structure
|
|---|
| 214 | c
|
|---|
| 215 | c ixatp(i,)
|
|---|
| 216 | c = indices for SMMP atoms pointing to PDB atoms
|
|---|
| 217 | c (=0, if atom not selected)
|
|---|
| 218 | c
|
|---|
| 219 | c --------------------------------- ref. point & axes
|
|---|
| 220 | c ixrfpt(3,),rfpt(3,),xrfax(3,),yrfax(3,),zrfax(3,)
|
|---|
| 221 | c
|
|---|
| 222 | c CALLS: tolost,getmol,bldmol,addend,atixpdb,setmvs,mklist,
|
|---|
| 223 | c dihedr,fnd3ba,setsys,getpar,setvar,rmsdopt
|
|---|
| 224 | c --------------------------------------------------------------------
|
|---|
| 225 |
|
|---|
| 226 | include 'INCL.H'
|
|---|
| 227 | include 'INCP.H'
|
|---|
| 228 |
|
|---|
| 229 | character res*3
|
|---|
| 230 | dimension rm(3,3),av1(3),av2(3),h(3)
|
|---|
| 231 |
|
|---|
| 232 |
|
|---|
| 233 | nml=0
|
|---|
| 234 | nrs=0
|
|---|
| 235 |
|
|---|
| 236 | do nc=1,nchp ! PDB chains
|
|---|
| 237 |
|
|---|
| 238 | c =============================== SMMP molecule
|
|---|
| 239 | nml=nml+1
|
|---|
| 240 | if (nml.gt.mxml) then
|
|---|
| 241 | write(*,'(a,i4,2a)')' pdbvars> NUMBER of chains > '
|
|---|
| 242 | # ,mxml,' in ',' ?'
|
|---|
| 243 | stop
|
|---|
| 244 | endif
|
|---|
| 245 | ntlml=nml
|
|---|
| 246 | c ----------------------------- 'nmml' = ChainID
|
|---|
| 247 | nmml(nml)=chnp(nc)
|
|---|
| 248 |
|
|---|
| 249 | c ======================================== get sequence
|
|---|
| 250 |
|
|---|
| 251 | irb=nrs+1
|
|---|
| 252 | ire=nrs+nchrsp(nc)
|
|---|
| 253 | c ----------------------------- # of 1st & last residue
|
|---|
| 254 | irsml1(nml)=irb
|
|---|
| 255 | irsml2(nml)=ire
|
|---|
| 256 |
|
|---|
| 257 | do irs=irb,ire ! residues of chain 'nc'
|
|---|
| 258 |
|
|---|
| 259 | nrs=nrs+1
|
|---|
| 260 |
|
|---|
| 261 | if (nrs.gt.mxrs) then
|
|---|
| 262 | write(*,'(a,i4,2a)') ' pdbvars> NUMBER of residues > '
|
|---|
| 263 | # ,mxrs,' in ',' ?'
|
|---|
| 264 | stop
|
|---|
| 265 | endif
|
|---|
| 266 |
|
|---|
| 267 | res=rsnmp(irs)
|
|---|
| 268 | call tolost(res)
|
|---|
| 269 |
|
|---|
| 270 | seq(nrs)=res
|
|---|
| 271 |
|
|---|
| 272 | if (.not.flex.and.irs.eq.irb.and.seq(nrs)(1:3).eq.'pro')
|
|---|
| 273 | # seq(nrs)='pron' ! only ECEPP/3
|
|---|
| 274 |
|
|---|
| 275 | enddo ! residues
|
|---|
| 276 |
|
|---|
| 277 | c ======================== get initial coords. for molecule 'nml'
|
|---|
| 278 | c with library values for deg. of freedom
|
|---|
| 279 |
|
|---|
| 280 | call getmol(nml) ! assemble res. data from libraries
|
|---|
| 281 |
|
|---|
| 282 | do i=1,6 ! initialize global parameters
|
|---|
| 283 | gbpr(i,nml)=zero
|
|---|
| 284 | enddo
|
|---|
| 285 |
|
|---|
| 286 | call bldmol(nml) ! co-ordinates
|
|---|
| 287 | call addend(nml,'nh2 ','cooh') ! modify ends
|
|---|
| 288 |
|
|---|
| 289 | call atixpdb(nml) ! get 'ixatp'
|
|---|
| 290 |
|
|---|
| 291 | c -------------------------- 'load' SMMP variable information
|
|---|
| 292 | call setmvs(nml) ! moving sets
|
|---|
| 293 | call mklist(nml) ! interaction lists
|
|---|
| 294 |
|
|---|
| 295 | c ================================= get variables for 'nml'
|
|---|
| 296 |
|
|---|
| 297 | ii=ivrml1(nml)
|
|---|
| 298 | do i=ii,ii+nvrml(nml)-1 ! SMMP torsions
|
|---|
| 299 |
|
|---|
| 300 | isrfvr(i) = .false.
|
|---|
| 301 | fxvr(i) = .false.
|
|---|
| 302 | idvr(i) = i
|
|---|
| 303 |
|
|---|
| 304 | it = ityvr(i)
|
|---|
| 305 | i1 = iatvr(i)
|
|---|
| 306 |
|
|---|
| 307 | if (it.eq.3) then ! torsion
|
|---|
| 308 |
|
|---|
| 309 | i2=iowat(i1) ! indices of SMMP atoms
|
|---|
| 310 | i3=iowat(i2)
|
|---|
| 311 | i4=iowat(i3)
|
|---|
| 312 |
|
|---|
| 313 | j1=ixatp(i1) ! inds. for corresp. PDB atoms
|
|---|
| 314 | j2=ixatp(i2)
|
|---|
| 315 | j3=ixatp(i3)
|
|---|
| 316 | j4=ixatp(i4)
|
|---|
| 317 |
|
|---|
| 318 | if (j1.le.0.or.j2.le.0.or.j3.le.0.or.j4.le.0) then
|
|---|
| 319 |
|
|---|
| 320 | vlvr(i) = toat(i1) ! default value from library
|
|---|
| 321 |
|
|---|
| 322 | else ! get value from PDB
|
|---|
| 323 |
|
|---|
| 324 | xat(i1)=xatp(j1)
|
|---|
| 325 | yat(i1)=yatp(j1)
|
|---|
| 326 | zat(i1)=zatp(j1)
|
|---|
| 327 |
|
|---|
| 328 | xat(i2)=xatp(j2)
|
|---|
| 329 | yat(i2)=yatp(j2)
|
|---|
| 330 | zat(i2)=zatp(j2)
|
|---|
| 331 |
|
|---|
| 332 | xat(i3)=xatp(j3)
|
|---|
| 333 | yat(i3)=yatp(j3)
|
|---|
| 334 | zat(i3)=zatp(j3)
|
|---|
| 335 |
|
|---|
| 336 | xat(i4)=xatp(j4)
|
|---|
| 337 | yat(i4)=yatp(j4)
|
|---|
| 338 | zat(i4)=zatp(j4)
|
|---|
| 339 |
|
|---|
| 340 | vlvr(i) = dihedr(i1,i2,i3,i4)
|
|---|
| 341 |
|
|---|
| 342 | isrfvr(i) = .true.
|
|---|
| 343 |
|
|---|
| 344 | endif
|
|---|
| 345 |
|
|---|
| 346 | elseif (it.eq.2) then ! b.angle
|
|---|
| 347 | vlvr(i)=baat(i1)
|
|---|
| 348 | elseif (it.eq.1) then ! b.length
|
|---|
| 349 | vlvr(i)=blat(i1)
|
|---|
| 350 | endif
|
|---|
| 351 |
|
|---|
| 352 | olvlvr(i) = vlvr(i)
|
|---|
| 353 |
|
|---|
| 354 | enddo ! SMMP vars.
|
|---|
| 355 |
|
|---|
| 356 | nvr = ivrml1(ntlml)+nvrml(ntlml)-1
|
|---|
| 357 |
|
|---|
| 358 | c ================================= global parameters for 'nml'
|
|---|
| 359 |
|
|---|
| 360 | c +++++++++++
|
|---|
| 361 | inew=0
|
|---|
| 362 |
|
|---|
| 363 | if (inew.eq.1) then
|
|---|
| 364 | c ++++++++++++++++++++++++
|
|---|
| 365 |
|
|---|
| 366 | call setvar(nml,vlvr)
|
|---|
| 367 |
|
|---|
| 368 | nrs = irsml2(nml)-irsml1(nml)+1
|
|---|
| 369 | call rmsdopt(nml,1,nrs,ixatp,xatp,yatp,zatp,0,rm,av1,av2,rmsd)
|
|---|
| 370 |
|
|---|
| 371 | c ---------------------------- retrieve ref. coords.
|
|---|
| 372 | c & transform acc. to opt. rmsd
|
|---|
| 373 | do i=1,3
|
|---|
| 374 | ii=ixrfpt(i,nml)
|
|---|
| 375 |
|
|---|
| 376 | h(1)=xat(ii)-av1(1)
|
|---|
| 377 | h(2)=yat(ii)-av1(2)
|
|---|
| 378 | h(3)=zat(ii)-av1(3)
|
|---|
| 379 |
|
|---|
| 380 | x=av2(1)
|
|---|
| 381 | y=av2(2)
|
|---|
| 382 | z=av2(3)
|
|---|
| 383 |
|
|---|
| 384 | do j=1,3
|
|---|
| 385 | x = x + rm(j,1) * h(j)
|
|---|
| 386 | y = y + rm(j,2) * h(j)
|
|---|
| 387 | z = z + rm(j,3) * h(j)
|
|---|
| 388 | enddo
|
|---|
| 389 |
|
|---|
| 390 | xat(ii)=x
|
|---|
| 391 | yat(ii)=y
|
|---|
| 392 | zat(ii)=z
|
|---|
| 393 | enddo
|
|---|
| 394 |
|
|---|
| 395 | call getpar(nml)
|
|---|
| 396 | call bldmol(nml) ! finally build SMMP molecule
|
|---|
| 397 |
|
|---|
| 398 | c ++++++++++++++++
|
|---|
| 399 | else ! old
|
|---|
| 400 | c ++++++++++++++++
|
|---|
| 401 |
|
|---|
| 402 | call fnd3ba(nml,i1,i2,i3) ! three 1st bb atoms in SMMP (e.g. n,ca,c')
|
|---|
| 403 |
|
|---|
| 404 | ixrfpt(1,nml)=i1
|
|---|
| 405 | ixrfpt(2,nml)=i2
|
|---|
| 406 | ixrfpt(3,nml)=i3
|
|---|
| 407 |
|
|---|
| 408 | c -------------------------------- retrieve ref. coords.
|
|---|
| 409 | do i=1,3
|
|---|
| 410 | ii=ixrfpt(i,nml)
|
|---|
| 411 | ix=ixatp(ii)
|
|---|
| 412 | if (ix.gt.0) then
|
|---|
| 413 | xat(ii)=xatp(ix)
|
|---|
| 414 | yat(ii)=yatp(ix)
|
|---|
| 415 | zat(ii)=zatp(ix)
|
|---|
| 416 | else
|
|---|
| 417 | write(*,'(3a)') ' pdbvars> missing PDB atom ',nmat(ii),
|
|---|
| 418 | # ' is ref. point for SMMP - cannot proceed !'
|
|---|
| 419 | endif
|
|---|
| 420 | enddo
|
|---|
| 421 |
|
|---|
| 422 | call getpar(nml)
|
|---|
| 423 | call setvar(nml,vlvr) ! finally build SMMP molecule
|
|---|
| 424 |
|
|---|
| 425 | nrs = irsml2(nml)-irsml1(nml)+1
|
|---|
| 426 | call rmsdopt(nml,1,nrs,ixatp,xatp,yatp,zatp,0,rm,av1,av2,rmsd)
|
|---|
| 427 |
|
|---|
| 428 | c ++++++++++
|
|---|
| 429 | endif
|
|---|
| 430 | c ++++++++++
|
|---|
| 431 |
|
|---|
| 432 | write(*,*) ' '
|
|---|
| 433 | write(*,*) ' Initial RMSD ',rmsd
|
|---|
| 434 |
|
|---|
| 435 | enddo ! chains(molecules)
|
|---|
| 436 |
|
|---|
| 437 | return
|
|---|
| 438 | end
|
|---|
| 439 | c ***************************
|
|---|
| 440 | subroutine atixpdb(nml)
|
|---|
| 441 |
|
|---|
| 442 | c --------------------------------------------------------------------
|
|---|
| 443 | c PURPOSE: get ixatp - pointer of each SMMP atom to corresponding atom
|
|---|
| 444 | c of reference structure loaded in 'INCP.H'
|
|---|
| 445 | c (=0 if no corr. atom in ref. str.)
|
|---|
| 446 | c
|
|---|
| 447 | c CALLS: toupst
|
|---|
| 448 | c --------------------------------------------------------------------
|
|---|
| 449 |
|
|---|
| 450 | include 'INCL.H'
|
|---|
| 451 | include 'INCP.H'
|
|---|
| 452 |
|
|---|
| 453 | character*4 atm
|
|---|
| 454 |
|
|---|
| 455 |
|
|---|
| 456 | atm=' '
|
|---|
| 457 |
|
|---|
| 458 | do irs=irsml1(nml),irsml2(nml) ! SMMP residues
|
|---|
| 459 |
|
|---|
| 460 | i1=irsatp(irs)
|
|---|
| 461 | i2=i1+nrsatp(irs)-1
|
|---|
| 462 |
|
|---|
| 463 | do iat=iatrs1(irs),iatrs2(irs) ! SMMP atoms
|
|---|
| 464 |
|
|---|
| 465 | ix=0
|
|---|
| 466 |
|
|---|
| 467 | if (nmat(iat)(1:1).ne.'h') then ! ignore hydrogens
|
|---|
| 468 |
|
|---|
| 469 | atm(2:4)=nmat(iat)(1:3)
|
|---|
| 470 | call toupst(atm)
|
|---|
| 471 |
|
|---|
| 472 | do i=i1,i2 ! atoms of PDB residue
|
|---|
| 473 | if (index(atnmp(i),atm).gt.0) then
|
|---|
| 474 | ix=i
|
|---|
| 475 | goto 1
|
|---|
| 476 | endif
|
|---|
| 477 | enddo
|
|---|
| 478 |
|
|---|
| 479 | c write(*,'(8a)') ' pdbvars> ',atm,' not found in '
|
|---|
| 480 | c # ,chnp(nc),' ',rsidp(irs),' ',rsnmp(irs)
|
|---|
| 481 |
|
|---|
| 482 | endif
|
|---|
| 483 |
|
|---|
| 484 | 1 ixatp(iat)=ix
|
|---|
| 485 |
|
|---|
| 486 | enddo ! SMMP atoms of 'irs'
|
|---|
| 487 | enddo ! residues
|
|---|
| 488 |
|
|---|
| 489 | return
|
|---|
| 490 | end
|
|---|
| 491 | c **************************
|
|---|
| 492 | subroutine getpar(nml)
|
|---|
| 493 |
|
|---|
| 494 | include 'INCL.H'
|
|---|
| 495 |
|
|---|
| 496 | parameter (TOL = 1.d-12)
|
|---|
| 497 |
|
|---|
| 498 | c Obtain molecule-fixed system (J,K,L) for 1st 3 bb-atoms,
|
|---|
| 499 | c -> determine global parameters: shifts dX,dY,dZ
|
|---|
| 500 | c & angles alpha,beta,gamma [rad], put into 'gbpr'
|
|---|
| 501 | c
|
|---|
| 502 | c CALLS: none
|
|---|
| 503 | c
|
|---|
| 504 |
|
|---|
| 505 | i1=ixrfpt(1,nml) ! from 'INCL.H'
|
|---|
| 506 | i2=ixrfpt(2,nml)
|
|---|
| 507 | i3=ixrfpt(3,nml)
|
|---|
| 508 | c -------------------------------------- Shifts
|
|---|
| 509 | gbpr(1,nml) = xat(i1)
|
|---|
| 510 | gbpr(2,nml) = yat(i1)
|
|---|
| 511 | gbpr(3,nml) = zat(i1)
|
|---|
| 512 |
|
|---|
| 513 | do i = 4,6
|
|---|
| 514 | gbpr(i,nml) = 0.d0
|
|---|
| 515 | enddo
|
|---|
| 516 | c --------------------------------- J
|
|---|
| 517 | h1=xat(i2)
|
|---|
| 518 | h2=yat(i2)
|
|---|
| 519 | h3=zat(i2)
|
|---|
| 520 |
|
|---|
| 521 | x1=h1-xat(i1)
|
|---|
| 522 | x2=h2-yat(i1)
|
|---|
| 523 | x3=h3-zat(i1)
|
|---|
| 524 |
|
|---|
| 525 | d=sqrt(x1*x1+x2*x2+x3*x3)
|
|---|
| 526 |
|
|---|
| 527 | x1=x1/d
|
|---|
| 528 | x2=x2/d
|
|---|
| 529 | x3=x3/d
|
|---|
| 530 | c --------------------------------- L
|
|---|
| 531 | h1=xat(i3)-h1
|
|---|
| 532 | h2=yat(i3)-h2
|
|---|
| 533 | h3=zat(i3)-h3
|
|---|
| 534 |
|
|---|
| 535 | z1=x2*h3-x3*h2
|
|---|
| 536 | z2=x3*h1-x1*h3
|
|---|
| 537 | z3=x1*h2-x2*h1
|
|---|
| 538 |
|
|---|
| 539 | d=sqrt(z1*z1+z2*z2+z3*z3)
|
|---|
| 540 |
|
|---|
| 541 | z1=z1/d
|
|---|
| 542 | z2=z2/d
|
|---|
| 543 | z3=z3/d
|
|---|
| 544 |
|
|---|
| 545 | c ---------------------------------- K
|
|---|
| 546 | y1=z2*x3-z3*x2
|
|---|
| 547 | y2=z3*x1-z1*x3
|
|---|
| 548 | y3=z1*x2-z2*x1
|
|---|
| 549 |
|
|---|
| 550 | if ( ( 1.d0 - abs(y3) ) .gt. TOL ) then ! ============ |beta| < PI/2
|
|---|
| 551 |
|
|---|
| 552 | c ----------------------------------------------- Y'
|
|---|
| 553 | d = sqrt( y1 * y1 + y2 * y2 )
|
|---|
| 554 | yp1= y1 / d
|
|---|
| 555 | yp2= y2 / d
|
|---|
| 556 |
|
|---|
| 557 | gbpr(4,nml)= atan2( -yp1, yp2 ) ! alpha
|
|---|
| 558 | gbpr(5,nml)= atan2( y3, ( y1*yp1+y2*yp2 ) ) ! beta
|
|---|
| 559 | gbpr(6,nml)= atan2( ( z1*yp2-z2*yp1 ),( x1*yp2-x2*yp1 ) ) ! gamma
|
|---|
| 560 |
|
|---|
| 561 | else ! ======================= |beta| = PI/2
|
|---|
| 562 |
|
|---|
| 563 | gbpr(4,nml) = atan2( x2, x1 ) ! alpha+gamma
|
|---|
| 564 |
|
|---|
| 565 | if ( abs(y3) .lt. 1.d0 ) then ! beta
|
|---|
| 566 | gbpr(5,nml) = asin(y3)
|
|---|
| 567 | else if ( y3 .gt. 0.d0 ) then
|
|---|
| 568 | gbpr(5,nml) = pi*.5d0
|
|---|
| 569 | else
|
|---|
| 570 | gbpr(5,nml) = -pi*.5d0
|
|---|
| 571 | endif
|
|---|
| 572 |
|
|---|
| 573 | gbpr(6,nml) = 0.0
|
|---|
| 574 |
|
|---|
| 575 | endif
|
|---|
| 576 |
|
|---|
| 577 | return
|
|---|
| 578 | end
|
|---|
| 579 |
|
|---|
